Difference between revisions of "Ec-09 003810"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-134 CPD1F-134] == * smiles: ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C))...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-2-Diglycerides 1-2-Diglycerides] == * common name: ** a 1,2-diglyceride * Synonym(s): ** a 1,...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-134 CPD1F-134] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-2-Diglycerides 1-2-Diglycerides] ==
* smiles:
+
** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
* inchi key:
+
** InChIKey=MHVYWTXXZIFXDT-PKZSZHAESA-M
+
 
* common name:
 
* common name:
** gibberellin A9
+
** a 1,2-diglyceride
* molecular weight:
+
** 315.388   
+
 
* Synonym(s):
 
* Synonym(s):
** C19-GAs
+
** a 1,2-diacylglycerol
** closed lactone gibberellin skeleton
+
** C19 skeleton
+
** C19-GA skeleton
+
** C19-gibberellin skeleton
+
** GA9
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN1F-165]]
+
* [[RXN-1602]]
* [[RXN-171]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[TRIACYLGLYCEROL-LIPASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a 1,2-diglyceride}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244370 25244370]
+
{{#set: common name=a 1,2-diacylglycerol}}
* CHEBI:
+
{{#set: consumed by=RXN-1602}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73255 73255]
+
{{#set: produced by=TRIACYLGLYCEROL-LIPASE-RXN}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C11863 C11863]
+
{{#set: smiles=C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
{{#set: inchi key=InChIKey=MHVYWTXXZIFXDT-PKZSZHAESA-M}}
+
{{#set: common name=gibberellin A9}}
+
{{#set: molecular weight=315.388    }}
+
{{#set: common name=C19-GAs|closed lactone gibberellin skeleton|C19 skeleton|C19-GA skeleton|C19-gibberellin skeleton|GA9}}
+
{{#set: consumed by=RXN1F-165|RXN-171}}
+

Revision as of 21:50, 17 March 2018

Metabolite 1-2-Diglycerides

  • common name:
    • a 1,2-diglyceride
  • Synonym(s):
    • a 1,2-diacylglycerol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links