Difference between revisions of "Ec-01 000060"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=A-LIPID-HYDROPEROXIDE A-LIPID-HYDROPEROXIDE] == * common name: ** a hydroperoxy-fatty-acyl-[lip...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-36 CPD-36] == * smiles: ** CC(=O)NC2(C(O)OC(CO)C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2) * inc...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-36 CPD-36] == |
| + | * smiles: | ||
| + | ** CC(=O)NC2(C(O)OC(CO)C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2) | ||
| + | * inchi key: | ||
| + | ** InChIKey=DLGJWSVWTWEWBJ-ZTVLJYEESA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** 4-deoxy-β-D-gluc-4-enuronosyl-(1,3)-N-acetyl-D-galactosamine |
| + | * molecular weight: | ||
| + | ** 378.312 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 4-deoxy-Δ4,5-β-D-GlcAp-(1→3)-β-D-GalNAc | ||
| + | ** 3-(4-deoxy-α-L-threo-hex-4-enopyranosyluronic acid)-2-acetamido-2-deoxy-D-galactose | ||
| + | ** 3-(4-deoxy-β-D-gluc-4-enuronosyl)-N-acetyl-D-galactosamine | ||
| + | ** chondroitin disaccharide (unsulfated) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12178]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878429 46878429] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57850 57850] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01310 C01310] | ||
| + | {{#set: smiles=CC(=O)NC2(C(O)OC(CO)C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2)}} | ||
| + | {{#set: inchi key=InChIKey=DLGJWSVWTWEWBJ-ZTVLJYEESA-M}} | ||
| + | {{#set: common name=4-deoxy-β-D-gluc-4-enuronosyl-(1,3)-N-acetyl-D-galactosamine}} | ||
| + | {{#set: molecular weight=378.312 }} | ||
| + | {{#set: common name=4-deoxy-Δ4,5-β-D-GlcAp-(1→3)-β-D-GalNAc|3-(4-deoxy-α-L-threo-hex-4-enopyranosyluronic acid)-2-acetamido-2-deoxy-D-galactose|3-(4-deoxy-β-D-gluc-4-enuronosyl)-N-acetyl-D-galactosamine|chondroitin disaccharide (unsulfated)}} | ||
| + | {{#set: consumed by=RXN-12178}} | ||
Revision as of 21:50, 17 March 2018
Contents
Metabolite CPD-36
- smiles:
- CC(=O)NC2(C(O)OC(CO)C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2)
- inchi key:
- InChIKey=DLGJWSVWTWEWBJ-ZTVLJYEESA-M
- common name:
- 4-deoxy-β-D-gluc-4-enuronosyl-(1,3)-N-acetyl-D-galactosamine
- molecular weight:
- 378.312
- Synonym(s):
- 4-deoxy-Δ4,5-β-D-GlcAp-(1→3)-β-D-GalNAc
- 3-(4-deoxy-α-L-threo-hex-4-enopyranosyluronic acid)-2-acetamido-2-deoxy-D-galactose
- 3-(4-deoxy-β-D-gluc-4-enuronosyl)-N-acetyl-D-galactosamine
- chondroitin disaccharide (unsulfated)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=O)NC2(C(O)OC(CO)C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2)" cannot be used as a page name in this wiki.
