Difference between revisions of "Ec-01 005740"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-3P GLYCEROL-3P] == * smiles: ** C(OP([O-])(=O)[O-])C(O)CO * inchi key: ** InChIKey=AWU...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5180 RXN0-5180] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2.5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5180 RXN0-5180] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.5.1 EC-2.5.1] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[DELTA3-ISOPENTENYL-PP]][c] '''+''' 1 [[FARNESYL-PP]][c] '''<=>''' 1 [[CPD0-1028]][c] '''+''' 1 [[PPI]][c] | |
− | + | * With common name(s): | |
− | + | ** 1 isopentenyl diphosphate[c] '''+''' 1 (2E,6E)-farnesyl diphosphate[c] '''<=>''' 1 2-cis,6-trans,10-trans-geranylgeranyl diphosphate[c] '''+''' 1 diphosphate[c] | |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * [[Ec-24_003910]] |
− | * [[ | + | ** [[pantograph]]-[[aragem]] |
− | * [[ | + | * [[Ec-27_002140]] |
− | * [[ | + | ** [[pantograph]]-[[aragem]] |
− | + | * [[Ec-08_002270]] | |
− | * [[ | + | ** [[pantograph]]-[[aragem]] |
− | * [[ | + | * [[Ec-18_000990]] |
− | * [[ | + | ** [[pantograph]]-[[aragem]] |
− | * [[ | + | * [[Ec-05_002690]] |
− | * [[ | + | ** [[pantograph]]-[[aragem]] |
− | * [[ | + | * [[Ec-17_003520]] |
− | == | + | ** [[pantograph]]-[[aragem]] |
− | + | == Pathways == | |
− | * [[ | + | == Reconstruction information == |
− | * | + | * Category: [[orthology]] |
− | * [[ | + | ** Source: [[orthology-aragem]] |
− | * [[ | + | *** Tool: [[pantograph]] |
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31282 31282] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R05555 R05555] |
− | + | {{#set: direction=REVERSIBLE}} | |
− | * LIGAND- | + | {{#set: ec number=EC-2.5.1}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: gene associated=Ec-24_003910|Ec-27_002140|Ec-08_002270|Ec-18_000990|Ec-05_002690|Ec-17_003520}} |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-aragem}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 21:51, 17 March 2018
Contents
Reaction RXN0-5180
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 DELTA3-ISOPENTENYL-PP[c] + 1 FARNESYL-PP[c] <=> 1 CPD0-1028[c] + 1 PPI[c]
- With common name(s):
- 1 isopentenyl diphosphate[c] + 1 (2E,6E)-farnesyl diphosphate[c] <=> 1 2-cis,6-trans,10-trans-geranylgeranyl diphosphate[c] + 1 diphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
External links