Difference between revisions of "RXN-12561"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] == * smiles: ** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N)) * inchi key...")
 
(Created page with "Category:Gene == Gene Ec-20_004950 == * left end position: ** 4967773 * transcription direction: ** NEGATIVE * right end position: ** 4971477 * centisome position: ** 96.3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] ==
+
== Gene Ec-20_004950 ==
−
* smiles:
+
* left end position:
−
** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))
+
** 4967773
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** queuine
+
** 4971477
−
* molecular weight:
+
* centisome position:
−
** 278.29    
+
** 96.34149    
 
* Synonym(s):
 
* Synonym(s):
−
** 7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine
+
** Esi_0231_0013
−
** base Q
+
** Esi0231_0013
−
** 4H-pyrrolo(2,3-d)pyrimidin-4-one, 2-amino-5-((((1S,4S,5R)-4,5-dihydroxy-2-cyclopenten-1-yl)amino)methyl)-1,7-dihydro-
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[DTMPKI-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** esiliculosus_genome
−
* [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]]
+
***go-term
 +
== Pathways associated ==
 +
* [[PWY-7210]]
 +
* [[PWY-7198]]
 +
* [[PWY-7184]]
 +
* [[PWY-7187]]
 +
* [[PWY-7197]]
 +
* [[PWY0-166]]
 +
* [[PWY-6545]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4967773}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289319 86289319]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=4971477}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77674 77674]
+
{{#set: centisome position=96.34149   }}
−
* HMDB : HMDB01495
+
{{#set: common name=Esi_0231_0013|Esi0231_0013}}
−
{{#set: smiles=C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))}}
+
{{#set: reaction associated=DTMPKI-RXN}}
−
{{#set: inchi key=InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O}}
+
{{#set: pathway associated=PWY-7210|PWY-7198|PWY-7184|PWY-7187|PWY-7197|PWY0-166|PWY-6545}}
−
{{#set: common name=queuine}}
+
−
{{#set: molecular weight=278.29   }}
+
−
{{#set: common name=7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine|base Q|4H-pyrrolo(2,3-d)pyrimidin-4-one, 2-amino-5-((((1S,4S,5R)-4,5-dihydroxy-2-cyclopenten-1-yl)amino)methyl)-1,7-dihydro-}}
+
−
{{#set: consumed or produced by=QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN}}
+

Revision as of 21:51, 17 March 2018

Gene Ec-20_004950

  • left end position:
    • 4967773
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4971477
  • centisome position:
    • 96.34149
  • Synonym(s):
    • Esi_0231_0013
    • Esi0231_0013

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-12561&oldid=14767"