Difference between revisions of "CPD-178"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DMPBQ DMPBQ] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(C(C)=C(C)C=1O)O))C)C * inchi key:...") |
(Created page with "Category:Gene == Gene Ec-15_000750 == * left end position: ** 1009329 * transcription direction: ** NEGATIVE * right end position: ** 1016740 * centisome position: ** 18.6...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-15_000750 == |
− | * | + | * left end position: |
− | ** | + | ** 1009329 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 1016740 |
− | * | + | * centisome position: |
− | ** | + | ** 18.697327 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0012_0041 | ||
+ | ** Esi0012_0041 | ||
+ | ** DHDPR | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * [[RXN-14014]] |
− | == | + | ** esiliculosus_genome |
− | * [[ | + | ***ec-number |
− | + | == Pathways associated == | |
+ | * [[PWY-5097]] | ||
+ | * [[PWY-2942]] | ||
+ | * [[DAPLYSINESYN-PWY]] | ||
+ | * [[PWY-2941]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1009329}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=1016740}} | |
− | + | {{#set: centisome position=18.697327 }} | |
− | + | {{#set: common name=Esi_0012_0041|Esi0012_0041|DHDPR}} | |
− | + | {{#set: reaction associated=RXN-14014}} | |
− | + | {{#set: pathway associated=PWY-5097|PWY-2942|DAPLYSINESYN-PWY|PWY-2941}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 21:52, 17 March 2018
Gene Ec-15_000750
- left end position:
- 1009329
- transcription direction:
- NEGATIVE
- right end position:
- 1016740
- centisome position:
- 18.697327
- Synonym(s):
- Esi_0012_0041
- Esi0012_0041
- DHDPR
Reactions associated
- RXN-14014
- esiliculosus_genome
- ec-number
- esiliculosus_genome