Difference between revisions of "RXN66-3"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7117 CPD-7117] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Reduced-ferredoxins Reduced-ferredoxins] == * common name: ** a reduced ferredoxin [iron-sulfur...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7117 CPD-7117] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Reduced-ferredoxins Reduced-ferredoxins] ==
* smiles:
+
** C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))
+
* inchi key:
+
** InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M
+
 
* common name:
 
* common name:
** delphinidin-3-O-β-D-glucoside
+
** a reduced ferredoxin [iron-sulfur] cluster
* molecular weight:
+
** 463.374   
+
 
* Synonym(s):
 
* Synonym(s):
** delfinidin-3-O-glucoside
+
** a reduced ferredoxin
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8228]]
+
* [[FERREDOXIN--NITRITE-REDUCTASE-RXN]]
 +
* [[1.3.7.4-RXN]]
 +
* [[ISPH2-RXN]]
 +
* [[RXN-7741]]
 +
* [[RXN-7740]]
 +
* [[RXN-17252]]
 +
* [[RXN0-882]]
 +
* [[SULFITE-REDUCTASE-FERREDOXIN-RXN]]
 +
* [[RXN-5061]]
 +
* [[1.3.7.3-RXN]]
 +
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
 +
* [[1.18.1.2-RXN]]
 +
* [[RXN0-884]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-15468]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-12878]]
 +
* [[HYDROG-RXN]]
 +
* [[PYRUFLAVREDUCT-RXN]]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPK12010278
+
{{#set: common name=a reduced ferredoxin [iron-sulfur] cluster}}
* PUBCHEM:
+
{{#set: common name=a reduced ferredoxin}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=165559 165559]
+
{{#set: consumed by=FERREDOXIN--NITRITE-REDUCTASE-RXN|1.3.7.4-RXN|ISPH2-RXN|RXN-7741|RXN-7740|RXN-17252|RXN0-882|SULFITE-REDUCTASE-FERREDOXIN-RXN|RXN-5061|1.3.7.3-RXN|GLUTAMATE-SYNTHASE-FERREDOXIN-RXN|1.18.1.2-RXN|RXN0-884}}
* CHEBI:
+
{{#set: produced by=RXN-15468}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=31463 31463]
+
{{#set: reversible reaction associated=RXN-12878|HYDROG-RXN|PYRUFLAVREDUCT-RXN}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C12138 C12138]
+
* HMDB : HMDB37997
+
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))}}
+
{{#set: inchi key=InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M}}
+
{{#set: common name=delphinidin-3-O-β-D-glucoside}}
+
{{#set: molecular weight=463.374    }}
+
{{#set: common name=delfinidin-3-O-glucoside}}
+
{{#set: consumed by=RXN-8228}}
+

Revision as of 21:52, 17 March 2018

Metabolite Reduced-ferredoxins

  • common name:
    • a reduced ferredoxin [iron-sulfur] cluster
  • Synonym(s):
    • a reduced ferredoxin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a reduced ferredoxin [iron-sulfur] cluster" cannot be used as a page name in this wiki.