Difference between revisions of "Ec-14 001310"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ITP ITP] == * smiles: ** C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17473 RXN-17473] == * direction: ** REVERSIBLE * common name: ** biotin synthase * Synonym(s):...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ITP ITP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17473 RXN-17473] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=HAEJPQIATWHALX-KQYNXXCUSA-J
+
 
* common name:
 
* common name:
−
** ITP
+
** biotin synthase
−
* molecular weight:
+
−
** 504.137   
+
 
* Synonym(s):
 
* Synonym(s):
−
** inosine triphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN0-5073]]
+
* With identifiers:
−
* [[RXN0-6382]]
+
** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[CPD-5662]][c] '''<=>''' 1 [[MET]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CH33ADO]][c] '''+''' 1 [[BIOTIN]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 S-adenosyl-L-methionine[c] '''+''' 1 9-mercaptodethiobiotin[c] '''<=>''' 1 L-methionine[c] '''+''' 1 H+[c] '''+''' 1 5'-deoxyadenosine[c] '''+''' 1 biotin[c]
−
* [[RXN-14120]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Ec-24_000980]]
 +
** ESILICULOSUS_GENOME
 +
***GO-TERM
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 132-06-9
+
{{#set: direction=REVERSIBLE}}
−
* PUBCHEM:
+
{{#set: common name=biotin synthase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25796439 25796439]
+
{{#set: gene associated=Ec-24_000980}}
−
* HMDB : HMDB00189
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00081 C00081]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61402 61402]
+
−
* BIGG : 33780
+
−
{{#set: smiles=C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))}}
+
−
{{#set: inchi key=InChIKey=HAEJPQIATWHALX-KQYNXXCUSA-J}}
+
−
{{#set: common name=ITP}}
+
−
{{#set: molecular weight=504.137    }}
+
−
{{#set: common name=inosine triphosphate}}
+
−
{{#set: consumed by=RXN0-5073|RXN0-6382}}
+
−
{{#set: consumed or produced by=RXN-14120}}
+

Revision as of 21:52, 17 March 2018

Reaction RXN-17473

  • direction:
    • REVERSIBLE
  • common name:
    • biotin synthase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 S-adenosyl-L-methionine[c] + 1 9-mercaptodethiobiotin[c] <=> 1 L-methionine[c] + 1 H+[c] + 1 5'-deoxyadenosine[c] + 1 biotin[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-14_001310&oldid=14843"