Difference between revisions of "Ec-00 008890"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-20_004180 == * left end position: ** 4367532 * transcription direction: ** POSITIVE * right end position: ** 4380177 * centisome position: ** 84.7...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] == |
− | * | + | * smiles: |
− | ** | + | ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23))) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J |
− | * | + | * common name: |
− | ** | + | ** XTP |
− | * | + | * molecular weight: |
− | ** | + | ** 520.136 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** xanthosine 5' triphosphate |
− | + | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN0-1603]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00700 C00700] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61314 61314] |
− | {{#set: common name= | + | * BIGG : 35735 |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245622 25245622] | ||
+ | * HMDB : HMDB00293 | ||
+ | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))}} | ||
+ | {{#set: inchi key=InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J}} | ||
+ | {{#set: common name=XTP}} | ||
+ | {{#set: molecular weight=520.136 }} | ||
+ | {{#set: common name=xanthosine 5' triphosphate}} | ||
+ | {{#set: consumed by=RXN0-1603}} |
Revision as of 22:52, 17 March 2018
Contents
Metabolite XTP
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))
- inchi key:
- InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J
- common name:
- XTP
- molecular weight:
- 520.136
- Synonym(s):
- xanthosine 5' triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))" cannot be used as a page name in this wiki.