Difference between revisions of "RXN-14272"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11528 CPD-11528] == * smiles: ** CCC=CCC4(C(=O)CCC(CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
 
(Created page with "Category:Gene == Gene Ec-12_003010 == * Synonym(s): ** Esi_0264_0018 ** Esi0264_0018 == Reactions associated == * DCMP-DEAMINASE-RXN ** pantograph-aragem == P...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11528 CPD-11528] ==
+
== Gene Ec-12_003010 ==
* smiles:
+
** CCC=CCC4(C(=O)CCC(CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
+
* inchi key:
+
** InChIKey=QGJLCXXJEFRWHP-BUMUVWNNSA-J
+
* common name:
+
** OPC4-3-ketoacyl-CoA
+
* molecular weight:
+
** 997.797   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0264_0018
 +
** Esi0264_0018
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[DCMP-DEAMINASE-RXN]]
* [[RXN-10703]]
+
** [[pantograph]]-[[aragem]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-7210]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=Esi_0264_0018|Esi0264_0018}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237346 44237346]
+
{{#set: reaction associated=DCMP-DEAMINASE-RXN}}
{{#set: smiles=CCC=CCC4(C(=O)CCC(CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}}
+
{{#set: pathway associated=PWY-7210}}
{{#set: inchi key=InChIKey=QGJLCXXJEFRWHP-BUMUVWNNSA-J}}
+
{{#set: common name=OPC4-3-ketoacyl-CoA}}
+
{{#set: molecular weight=997.797    }}
+
{{#set: produced by=RXN-10703}}
+

Revision as of 21:53, 17 March 2018

Gene Ec-12_003010

  • Synonym(s):
    • Esi_0264_0018
    • Esi0264_0018

Reactions associated

Pathways associated

External links