Difference between revisions of "RXN-9635"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-00_007940 == * left end position: ** 12866947 * transcription direction: ** NEGATIVE * right end position: ** 12868751 * centisome position: ** 67...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-696 CPD-696] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-00_007940 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-696 CPD-696] ==
* left end position:
+
* smiles:
** 12866947
+
** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N
* right end position:
+
* common name:
** 12868751
+
** 24-methylenecycloartanol
* centisome position:
+
* molecular weight:
** 67.91225    
+
** 440.751    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0587_0001
+
** 24(28)-methylenecycloartanol
** Esi0587_0001
+
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** esiliculosus_genome
+
* [[RXN-4021]]
***go-term
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=12866947}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658794 90658794]
{{#set: right end position=12868751}}
+
* LIGAND-CPD:
{{#set: centisome position=67.91225   }}
+
** [http://www.genome.jp/dbget-bin/www_bget?C08830 C08830]
{{#set: common name=Esi_0587_0001|Esi0587_0001}}
+
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}}
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
+
{{#set: inchi key=InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N}}
 +
{{#set: common name=24-methylenecycloartanol}}
 +
{{#set: molecular weight=440.751   }}
 +
{{#set: common name=24(28)-methylenecycloartanol}}
 +
{{#set: produced by=RXN-4021}}

Revision as of 21:53, 17 March 2018

Metabolite CPD-696

  • smiles:
    • CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
  • inchi key:
    • InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N
  • common name:
    • 24-methylenecycloartanol
  • molecular weight:
    • 440.751
  • Synonym(s):
    • 24(28)-methylenecycloartanol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))" cannot be used as a page name in this wiki.