Difference between revisions of "2.7.10.1-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17815 CPD-17815] == * smiles: ** CCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
 
(Created page with "Category:Gene == Gene Ec-02_005870 == * left end position: ** 6052597 * transcription direction: ** NEGATIVE * right end position: ** 6057533 * centisome position: ** 92.7...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17815 CPD-17815] ==
+
== Gene Ec-02_005870 ==
−
* smiles:
+
* left end position:
−
** CCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 6052597
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LGTVDWICXIBIOI-UBPKJMQESA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (11Z)-3-oxo-hexadecenoyl-CoA
+
** 6057533
−
* molecular weight:
+
* centisome position:
−
** 1013.883    
+
** 92.72045    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0082_0066
 +
** Esi0082_0066
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[3.1.26.3-RXN]]
−
* [[RXN-16559]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=6052597}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289728 86289728]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=6057533}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=79021 79021]
+
{{#set: centisome position=92.72045    }}
−
{{#set: smiles=CCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=Esi_0082_0066|Esi0082_0066}}
−
{{#set: inchi key=InChIKey=LGTVDWICXIBIOI-UBPKJMQESA-J}}
+
{{#set: reaction associated=3.1.26.3-RXN}}
−
{{#set: common name=(11Z)-3-oxo-hexadecenoyl-CoA}}
+
−
{{#set: molecular weight=1013.883    }}
+
−
{{#set: produced by=RXN-16559}}
+

Revision as of 21:53, 17 March 2018

Gene Ec-02_005870

  • left end position:
    • 6052597
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 6057533
  • centisome position:
    • 92.72045
  • Synonym(s):
    • Esi_0082_0066
    • Esi0082_0066

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=2.7.10.1-RXN&oldid=14903"