Difference between revisions of "L-1-LYSOPHOSPHATIDATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3762 CPD-3762] == * smiles: ** C1(=NC(C(N)=O)C(N)=N1) * inchi key: ** InChIKey=PYNDTGFTPOZG...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9635 RXN-9635] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-octadec-2-enoyl-[acyl-c...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3762 CPD-3762] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9635 RXN-9635] ==
−
* smiles:
+
* direction:
−
** C1(=NC(C(N)=O)C(N)=N1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=PYNDTGFTPOZGRW-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** 5-amino-4-imidazolecarboxyamide
+
** trans-octadec-2-enoyl-[acyl-carrier-protein] reductase
−
* molecular weight:
+
** Glucose/ribitol dehydrogenase
−
** 126.118   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
 
* Synonym(s):
 
* Synonym(s):
−
** 1H-imidazole-4-carboxamide, 5-amino-
 
−
** 5(4)-amino-4(5)-imidazolecarboxamide
 
−
** 5-aminoimidazole-4-carboxamide
 
−
** 4-amino-5-carbamoylimidazole
 
−
** 4-amino-5-imidazolecarboxamide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[Octadec-2-enoyl-ACPs]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[Stearoyl-ACPs]][c]
−
* [[RXN-14270]]
+
* With common name(s):
 +
** 1 a trans-octadec-2-enoyl-[acp][c] '''+''' 1 NADH[c] '''+''' 1 H+[c] '''=>''' 1 NAD+[c] '''+''' 1 a stearoyl-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Ec-27_002470]]
 +
** ESILICULOSUS_GENOME
 +
***EC-NUMBER
 +
** [[pantograph]]-[[aragem]]
 +
== Pathways  ==
 +
* [[PWY-5989]], stearate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5989 PWY-5989]
 +
** '''6''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04051 C04051]
+
{{#set: common name=trans-octadec-2-enoyl-[acyl-carrier-protein] reductase}}
−
* CHEBI:
+
{{#set: common name=Glucose/ribitol dehydrogenase}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=2030 2030]
+
{{#set: ec number=EC-1.3.1.9}}
−
* PUBCHEM:
+
{{#set: gene associated=Ec-27_002470}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202832 25202832]
+
{{#set: in pathway=PWY-5989}}
−
* HMDB : HMDB03192
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: smiles=C1(=NC(C(N)=O)C(N)=N1)}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
−
{{#set: inchi key=InChIKey=PYNDTGFTPOZGRW-UHFFFAOYSA-N}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: common name=5-amino-4-imidazolecarboxyamide}}
+
−
{{#set: molecular weight=126.118    }}
+
−
{{#set: common name=1H-imidazole-4-carboxamide, 5-amino-|5(4)-amino-4(5)-imidazolecarboxamide|5-aminoimidazole-4-carboxamide|4-amino-5-carbamoylimidazole|4-amino-5-imidazolecarboxamide}}
+
−
{{#set: consumed or produced by=RXN-14270}}
+

Revision as of 21:53, 17 March 2018

Reaction RXN-9635

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • trans-octadec-2-enoyl-[acyl-carrier-protein] reductase
    • Glucose/ribitol dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5989, stearate biosynthesis II (bacteria and plants): PWY-5989
    • 6 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

"trans-octadec-2-enoyl-[acyl-carrier-protein] reductase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=L-1-LYSOPHOSPHATIDATE&oldid=14914"