Difference between revisions of "CPD-202"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7107 CPD-7107] == * smiles: ** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(C(C)C)=O)O))C * inch...") |
(Created page with "Category:Gene == Gene Ec-00_007940 == * left end position: ** 12866947 * transcription direction: ** NEGATIVE * right end position: ** 12868751 * centisome position: ** 67...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Ec-00_007940 == |
| − | * | + | * left end position: |
| − | ** | + | ** 12866947 |
| − | * | + | * transcription direction: |
| − | ** | + | ** NEGATIVE |
| − | * | + | * right end position: |
| − | ** | + | ** 12868751 |
| − | * | + | * centisome position: |
| − | ** | + | ** 67.91225 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** Esi_0587_0001 |
| + | ** Esi0587_0001 | ||
| − | == | + | == Reactions associated == |
| − | + | * [[PEPTIDYLPROLYL-ISOMERASE-RXN]] | |
| − | * [[ | + | ** esiliculosus_genome |
| − | == | + | ***go-term |
| + | == Pathways associated == | ||
== External links == | == External links == | ||
| − | + | {{#set: left end position=12866947}} | |
| − | + | {{#set: transcription direction=NEGATIVE}} | |
| − | {{#set: | + | {{#set: right end position=12868751}} |
| − | {{#set: | + | {{#set: centisome position=67.91225 }} |
| − | {{#set: | + | {{#set: common name=Esi_0587_0001|Esi0587_0001}} |
| − | {{#set: | + | {{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}} |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
Revision as of 21:53, 17 March 2018
Gene Ec-00_007940
- left end position:
- 12866947
- transcription direction:
- NEGATIVE
- right end position:
- 12868751
- centisome position:
- 67.91225
- Synonym(s):
- Esi_0587_0001
- Esi0587_0001
Reactions associated
- PEPTIDYLPROLYL-ISOMERASE-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome
