Difference between revisions of "ARG-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] == * smiles: ** CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(...")
 
(Created page with "Category:Gene == Gene Ec-12_005680 == * left end position: ** 5174692 * transcription direction: ** POSITIVE * right end position: ** 5184527 * centisome position: ** 62.0...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] ==
+
== Gene Ec-12_005680 ==
* smiles:
+
* left end position:
** CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O
+
** 5174692
* inchi key:
+
* transcription direction:
** InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N
+
** POSITIVE
* common name:
+
* right end position:
** apo-4'-lycopenal
+
** 5184527
* molecular weight:
+
* centisome position:
** 482.748    
+
** 62.07605    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0081_0051
 +
** Esi0081_0051
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[PROTEIN-KINASE-RXN]]
* [[RXN-11999]]
+
** esiliculosus_genome
== Reaction(s) of unknown directionality ==
+
***go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=5174692}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986183 50986183]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O}}
+
{{#set: right end position=5184527}}
{{#set: inchi key=InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N}}
+
{{#set: centisome position=62.07605    }}
{{#set: common name=apo-4'-lycopenal}}
+
{{#set: common name=Esi_0081_0051|Esi0081_0051}}
{{#set: molecular weight=482.748    }}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
{{#set: produced by=RXN-11999}}
+

Revision as of 21:54, 17 March 2018

Gene Ec-12_005680

  • left end position:
    • 5174692
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5184527
  • centisome position:
    • 62.07605
  • Synonym(s):
    • Esi_0081_0051
    • Esi0081_0051

Reactions associated

Pathways associated

External links