Difference between revisions of "DOLICHOL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9556 RXN-9556] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-cis-vaccenoyl-[acyl-car...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9556 RXN-9556] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
 +
* inchi key:
 +
** InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N
 
* common name:
 
* common name:
−
** 3-oxo-cis-vaccenoyl-[acyl-carrier protein] reductase
+
** 14-hydroxylanosterol
−
** NAD(P)-binding domain
+
* molecular weight:
−
* ec number:
+
** 442.724   
−
** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN66-304]]
−
** 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[3-oxo-cis-vaccenoyl-ACPs]][c] '''=>''' 1 [[R-3-hydroxy-cis-vaccenoyl-ACPs]][c] '''+''' 1 [[NADP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN66-303]]
−
** 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 a 3-oxo-cis-vacc-11-enoyl-[acp][c] '''=>''' 1 (R)-3-hydroxy-cis-vacc-11-enoyl-[acp][c] '''+''' 1 NADP+[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-01_007100]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-5973]], cis-vaccenate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5973 PWY-5973]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=3-oxo-cis-vaccenoyl-[acyl-carrier protein] reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298935 22298935]
−
{{#set: common name=NAD(P)-binding domain}}
+
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
−
{{#set: ec number=EC-1.1.1.100}}
+
{{#set: inchi key=InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N}}
−
{{#set: gene associated=Ec-01_007100}}
+
{{#set: common name=14-hydroxylanosterol}}
−
{{#set: in pathway=PWY-5973}}
+
{{#set: molecular weight=442.724    }}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: consumed by=RXN66-304}}
−
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: produced by=RXN66-303}}

Revision as of 21:54, 17 March 2018

Metabolite CPD-4568

  • smiles:
    • CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
  • inchi key:
    • InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N
  • common name:
    • 14-hydroxylanosterol
  • molecular weight:
    • 442.724
  • Synonym(s):
    • 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=DOLICHOL&oldid=14961"