Difference between revisions of "Stearoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(...")
 
(Created page with "Category:Gene == Gene Ec-19_000380 == * Synonym(s): ** Esi_0054_0114 ** Esi0054_0114 == Reactions associated == * RXN-8443 ** pantograph-aragem == Pathways as...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] ==
+
== Gene Ec-19_000380 ==
* smiles:
+
** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
+
* inchi key:
+
** InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N
+
* common name:
+
** 14-hydroxylanosterol
+
* molecular weight:
+
** 442.724   
+
 
* Synonym(s):
 
* Synonym(s):
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol
+
** Esi_0054_0114
 +
** Esi0054_0114
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN66-304]]
+
* [[RXN-8443]]
== Reaction(s) known to produce the compound ==
+
** [[pantograph]]-[[aragem]]
* [[RXN66-303]]
+
== Pathways associated ==
== Reaction(s) of unknown directionality ==
+
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=Esi_0054_0114|Esi0054_0114}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298935 22298935]
+
{{#set: reaction associated=RXN-8443}}
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
+
{{#set: pathway associated=PWY-5381}}
{{#set: inchi key=InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N}}
+
{{#set: common name=14-hydroxylanosterol}}
+
{{#set: molecular weight=442.724    }}
+
{{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol}}
+
{{#set: consumed by=RXN66-304}}
+
{{#set: produced by=RXN66-303}}
+

Revision as of 22:54, 17 March 2018

Gene Ec-19_000380

  • Synonym(s):
    • Esi_0054_0114
    • Esi0054_0114

Reactions associated

Pathways associated

External links