Difference between revisions of "Ec-24 000030"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-27_003930 == * left end position: ** 3445813 * transcription direction: ** POSITIVE * right end position: ** 3449053 * centisome position: ** 53.4...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-27_003930 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] ==
−
* left end position:
+
* smiles:
−
** 3445813
+
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N
−
* right end position:
+
* common name:
−
** 3449053
+
** campest-4-en-3-one
−
* centisome position:
+
* molecular weight:
−
** 53.42423    
+
** 398.671    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0000_0463
+
** methylcholestenone
−
** Esi0000_0463
+
** (24R)-24-methyl-cholest-4-en-3-one
−
** RPE
+
** 3-dehydro-Δ4-5-campesterol
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RIBULP3EPIM-RXN]]
+
* [[RXN-711]]
−
** esiliculosus_genome
+
* [[RXN-4231]]
−
***ec-number
+
== Reaction(s) known to produce the compound ==
−
** [[pantograph]]-[[aragem]]
+
== Reaction(s) of unknown directionality ==
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways associated ==
+
−
* [[P124-PWY]]
+
−
* [[CALVIN-PWY]]
+
−
* [[P21-PWY]]
+
−
* [[PWY-5723]]
+
−
* [[PWY-1861]]
+
−
* [[P122-PWY]]
+
−
* [[P185-PWY]]
+
−
* [[NONOXIPENT-PWY]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=3445813}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200612 25200612]
−
{{#set: right end position=3449053}}
+
* LIGAND-CPD:
−
{{#set: centisome position=53.42423   }}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15785 C15785]
−
{{#set: common name=Esi_0000_0463|Esi0000_0463|RPE}}
+
* HMDB : HMDB12196
−
{{#set: reaction associated=RIBULP3EPIM-RXN}}
+
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: pathway associated=P124-PWY|CALVIN-PWY|P21-PWY|PWY-5723|PWY-1861|P122-PWY|P185-PWY|NONOXIPENT-PWY}}
+
{{#set: inchi key=InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N}}
 +
{{#set: common name=campest-4-en-3-one}}
 +
{{#set: molecular weight=398.671   }}
 +
{{#set: common name=methylcholestenone|(24R)-24-methyl-cholest-4-en-3-one|3-dehydro-Δ4-5-campesterol}}
 +
{{#set: consumed by=RXN-711|RXN-4231}}

Revision as of 21:54, 17 March 2018

Metabolite CPD-698

  • smiles:
    • CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N
  • common name:
    • campest-4-en-3-one
  • molecular weight:
    • 398.671
  • Synonym(s):
    • methylcholestenone
    • (24R)-24-methyl-cholest-4-en-3-one
    • 3-dehydro-Δ4-5-campesterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-24_000030&oldid=14988"