Difference between revisions of "RXN-14187"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15895 CPD-15895] == * smiles: ** [CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O * inchi key: ** InCh...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Alkyl-enyl-acyl-gly-P-EtOH-amines Alkyl-enyl-acyl-gly-P-EtOH-amines] == * common name: ** a pla...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15895 CPD-15895] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Alkyl-enyl-acyl-gly-P-EtOH-amines Alkyl-enyl-acyl-gly-P-EtOH-amines] ==
* smiles:
+
** [CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O
+
* inchi key:
+
** InChIKey=PPQRONHOSHZGFQ-LMVFSUKVSA-L
+
 
* common name:
 
* common name:
** keto-D-ribose 5-phosphate
+
** a plasmenylethanolamine
* molecular weight:
+
** 228.095   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a 1-Z-alkenyl-2-acylglycerophosphoethanolamine
 +
** an O-1-Z-alk-1-enyl-2-acyl-sn-glycero-3-phosphoethanolamine
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17735]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15346]]
 
* [[RXN-14997]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a plasmenylethanolamine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21115541 21115541]
+
{{#set: common name=a 1-Z-alkenyl-2-acylglycerophosphoethanolamine|an O-1-Z-alk-1-enyl-2-acyl-sn-glycero-3-phosphoethanolamine}}
* CHEBI:
+
{{#set: consumed by=RXN-17735}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58273 58273]
+
{{#set: smiles=[CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O}}
+
{{#set: inchi key=InChIKey=PPQRONHOSHZGFQ-LMVFSUKVSA-L}}
+
{{#set: common name=keto-D-ribose 5-phosphate}}
+
{{#set: molecular weight=228.095    }}
+
{{#set: produced by=RXN-15346|RXN-14997}}
+

Revision as of 21:54, 17 March 2018

Metabolite Alkyl-enyl-acyl-gly-P-EtOH-amines

  • common name:
    • a plasmenylethanolamine
  • Synonym(s):
    • a 1-Z-alkenyl-2-acylglycerophosphoethanolamine
    • an O-1-Z-alk-1-enyl-2-acyl-sn-glycero-3-phosphoethanolamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links