Difference between revisions of "RNA-Holder"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MEVALONATE MEVALONATE] == * smiles: ** CC(O)(CCO)CC(=O)[O-] * inchi key: ** InChIKey=KJTLQQUUPV...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Trans-D2-decenoyl-ACPs Trans-D2-decenoyl-ACPs] == * common name: ** a (2E)-dec-2-enoyl-[acp] *...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MEVALONATE MEVALONATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Trans-D2-decenoyl-ACPs Trans-D2-decenoyl-ACPs] ==
* smiles:
+
** CC(O)(CCO)CC(=O)[O-]
+
* inchi key:
+
** InChIKey=KJTLQQUUPVSXIM-ZCFIWIBFSA-M
+
 
* common name:
 
* common name:
** (R)-mevalonate
+
** a (2E)-dec-2-enoyl-[acp]
* molecular weight:
+
** 147.15   
+
 
* Synonym(s):
 
* Synonym(s):
** mevalonate
+
** a trans-Δ2-decenoyl-[acp]
** mevalonic acid
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-9660]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9655]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[MEVALONATE-KINASE-RXN]]
+
* [[5.3.3.14-RXN]]
* [[1.1.1.34-RXN]]
+
 
== External links  ==
 
== External links  ==
* DRUGBANK : DB03518
+
{{#set: common name=a (2E)-dec-2-enoyl-[acp]}}
* PUBCHEM:
+
{{#set: common name=a trans-Δ2-decenoyl-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5288798 5288798]
+
{{#set: consumed by=RXN-9660}}
* HMDB : HMDB59629
+
{{#set: produced by=RXN-9655}}
* LIGAND-CPD:
+
{{#set: reversible reaction associated=5.3.3.14-RXN}}
** [http://www.genome.jp/dbget-bin/www_bget?C00418 C00418]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.4450890.html 4450890]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36464 36464]
+
* METABOLIGHTS : MTBLC36464
+
{{#set: smiles=CC(O)(CCO)CC(=O)[O-]}}
+
{{#set: inchi key=InChIKey=KJTLQQUUPVSXIM-ZCFIWIBFSA-M}}
+
{{#set: common name=(R)-mevalonate}}
+
{{#set: molecular weight=147.15    }}
+
{{#set: common name=mevalonate|mevalonic acid}}
+
{{#set: consumed or produced by=MEVALONATE-KINASE-RXN|1.1.1.34-RXN}}
+

Revision as of 21:54, 17 March 2018

Metabolite Trans-D2-decenoyl-ACPs

  • common name:
    • a (2E)-dec-2-enoyl-[acp]
  • Synonym(s):
    • a trans-Δ2-decenoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a (2E)-dec-2-enoyl-[acp" cannot be used as a page name in this wiki.
"a trans-Δ2-decenoyl-[acp" cannot be used as a page name in this wiki.