Difference between revisions of "DEOXYHYPUSINE-MONOOXYGENASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] == * smiles: ** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O * inchi key: *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-3-METHYL-GLUTACONYL-COA TRANS-3-METHYL-GLUTACONYL-COA] == * smiles: ** CC(=CC(=O)SCCNC(=O...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-3-METHYL-GLUTACONYL-COA TRANS-3-METHYL-GLUTACONYL-COA] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])CC(=O)[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=GXKSHRDAHFLWPN-RKYLSHMCSA-I |
* common name: | * common name: | ||
| − | ** | + | ** 3-methylglutaconyl-CoA |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 888.606 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** trans-3-methylglutaconyl-CoA |
| − | ** | + | ** (E)-3-methylglutaconyl-1-CoA |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[METHYLGLUTACONYL-COA-HYDRATASE-RXN]] | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657229 90657229] |
| − | {{#set: smiles= | + | * CHEBI: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15488 15488] |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: molecular weight= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03231 C03231] |
| − | {{#set: common name= | + | * HMDB : HMDB01057 |
| − | {{#set: | + | {{#set: smiles=CC(=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])CC(=O)[O-]}} |
| + | {{#set: inchi key=InChIKey=GXKSHRDAHFLWPN-RKYLSHMCSA-I}} | ||
| + | {{#set: common name=3-methylglutaconyl-CoA}} | ||
| + | {{#set: molecular weight=888.606 }} | ||
| + | {{#set: common name=trans-3-methylglutaconyl-CoA|(E)-3-methylglutaconyl-1-CoA}} | ||
| + | {{#set: produced by=METHYLCROTONYL-COA-CARBOXYLASE-RXN}} | ||
| + | {{#set: reversible reaction associated=METHYLGLUTACONYL-COA-HYDRATASE-RXN}} | ||
Revision as of 21:55, 17 March 2018
Contents
Metabolite TRANS-3-METHYL-GLUTACONYL-COA
- smiles:
- CC(=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])CC(=O)[O-]
- inchi key:
- InChIKey=GXKSHRDAHFLWPN-RKYLSHMCSA-I
- common name:
- 3-methylglutaconyl-CoA
- molecular weight:
- 888.606
- Synonym(s):
- trans-3-methylglutaconyl-CoA
- (E)-3-methylglutaconyl-1-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])CC(=O)[O-" cannot be used as a page name in this wiki.
