Difference between revisions of "P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15924 CPD-15924] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O * inchi ke...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-Hydroxy-3-polyprenylbenzoates 4-Hydroxy-3-polyprenylbenzoates] == * common name: ** a 4-hydro...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-Hydroxy-3-polyprenylbenzoates 4-Hydroxy-3-polyprenylbenzoates] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a 4-hydroxy-3-polyprenylbenzoate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-11368]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a 4-hydroxy-3-polyprenylbenzoate}} | |
| − | + | {{#set: reversible reaction associated=RXN-11368}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Revision as of 21:55, 17 March 2018
Contents
Metabolite 4-Hydroxy-3-polyprenylbenzoates
- common name:
- a 4-hydroxy-3-polyprenylbenzoate
- Synonym(s):
