Difference between revisions of "Ec-12 004550"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17328 CPD-17328] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
 
(Created page with "Category:Gene == Gene Ec-26_004490 == * left end position: ** 4691585 * transcription direction: ** POSITIVE * right end position: ** 4705751 * centisome position: ** 71.2...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17328 CPD-17328] ==
+
== Gene Ec-26_004490 ==
−
* smiles:
+
* left end position:
−
** CCCCCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 4691585
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OKOXEYTYHDPTEW-GJYKHRJNSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (9Z,12Z,15Z,18Z)-tetracosatetraenoyl-CoA
+
** 4705751
−
* molecular weight:
+
* centisome position:
−
** 1106.066    
+
** 71.26442    
 
* Synonym(s):
 
* Synonym(s):
−
** (9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl-CoA
+
** Esi_0280_0027
 +
** Esi0280_0027
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17112]]
+
* [[3.4.25.1-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
* [[RXN-17111]]
+
***automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4691585}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581220 71581220]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=4705751}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74087 74087]
+
{{#set: centisome position=71.26442   }}
−
{{#set: smiles=CCCCCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: common name=Esi_0280_0027|Esi0280_0027}}
−
{{#set: inchi key=InChIKey=OKOXEYTYHDPTEW-GJYKHRJNSA-J}}
+
{{#set: reaction associated=3.4.25.1-RXN}}
−
{{#set: common name=(9Z,12Z,15Z,18Z)-tetracosatetraenoyl-CoA}}
+
−
{{#set: molecular weight=1106.066   }}
+
−
{{#set: common name=(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl-CoA}}
+
−
{{#set: consumed by=RXN-17112}}
+
−
{{#set: produced by=RXN-17111}}
+

Revision as of 21:56, 17 March 2018

Gene Ec-26_004490

  • left end position:
    • 4691585
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4705751
  • centisome position:
    • 71.26442
  • Synonym(s):
    • Esi_0280_0027
    • Esi0280_0027

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-12_004550&oldid=15076"