Difference between revisions of "Ec-01 005920"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13713 CPD-13713] == * smiles: ** C(OP(=O)([O-])O[Se](=O)(=O)O)C1(OC(C(O)C(O)1)N3(C=NC2(C(N)...")
 
(Created page with "Category:Gene == Gene Ec-25_003550 == * Synonym(s): ** Esi_0378_0002 ** Esi0378_0002 == Reactions associated == * GAPOXNPHOSPHN-RXN ** pantograph-aragem ** ...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13713 CPD-13713] ==
+
== Gene Ec-25_003550 ==
−
* smiles:
+
−
** C(OP(=O)([O-])O[Se](=O)(=O)O)C1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23)))
+
−
* inchi key:
+
−
** InChIKey=XCADVMZZFPIERR-DEGSGYPDSA-M
+
−
* common name:
+
−
** adenosine 5'-phosphoselenate
+
−
* molecular weight:
+
−
** 473.174   
+
 
* Synonym(s):
 
* Synonym(s):
−
** adenylyl-selenate
+
** Esi_0378_0002
−
** APSe
+
** Esi0378_0002
−
** adenosine phosphoselenate
+
−
** adenylylselenate
+
−
** adenosine-5'-phosphoselenate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[GAPOXNPHOSPHN-RXN]]
−
* [[RXN-12720]]
+
** [[pantograph]]-[[aragem]]
−
== Reaction(s) of unknown directionality ==
+
** [[pantograph]]-[[aragem]]
 +
== Pathways associated ==
 +
* [[PWY-1042]]
 +
* [[PWY-7003]]
 +
* [[GLUCONEO-PWY]]
 +
* [[GLYCOLYSIS]]
 +
* [[PWY-6901]]
 +
* [[SUCSYN-PWY]]
 +
* [[P124-PWY]]
 +
* [[ANAGLYCOLYSIS-PWY]]
 +
* [[P122-PWY]]
 +
* [[P185-PWY]]
 +
* [[PWY-5484]]
 +
* [[PWY66-399]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=Esi_0378_0002|Esi0378_0002}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657723 90657723]
+
{{#set: reaction associated=GAPOXNPHOSPHN-RXN}}
−
* CHEBI:
+
{{#set: pathway associated=PWY-1042|PWY-7003|GLUCONEO-PWY|GLYCOLYSIS|PWY-6901|SUCSYN-PWY|P124-PWY|ANAGLYCOLYSIS-PWY|P122-PWY|P185-PWY|PWY-5484|PWY66-399}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=2485 2485]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C05686 C05686]
+
−
* HMDB : HMDB04112
+
−
{{#set: smiles=C(OP(=O)([O-])O[Se](=O)(=O)O)C1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23)))}}
+
−
{{#set: inchi key=InChIKey=XCADVMZZFPIERR-DEGSGYPDSA-M}}
+
−
{{#set: common name=adenosine 5'-phosphoselenate}}
+
−
{{#set: molecular weight=473.174    }}
+
−
{{#set: common name=adenylyl-selenate|APSe|adenosine phosphoselenate|adenylylselenate|adenosine-5'-phosphoselenate}}
+
−
{{#set: produced by=RXN-12720}}
+

Revision as of 21:56, 17 March 2018

Gene Ec-25_003550

  • Synonym(s):
    • Esi_0378_0002
    • Esi0378_0002

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_005920&oldid=15117"