Difference between revisions of "RXN-7607"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-02_005310 == * left end position: ** 5575895 * transcription direction: ** NEGATIVE * right end position: ** 5584342 * centisome position: ** 85.4...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(=NC(=O)N1)N)N=C2)))O3)O))OP(OP(OP(=O)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C3(C(CC(N2(C1(=C(C(=NC(=O)N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J |
| − | * | + | * common name: |
| − | ** | + | ** 2-hydroxy-dATP |
| − | * | + | * molecular weight: |
| − | ** | + | ** 503.152 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2-hydroxydeoxyadenosine 5'-triphosphate |
| − | ** | + | ** 2'-deoxyisoguanosine triphosphate |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-14290]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289402 86289402] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77897 77897] |
| − | {{#set: common name= | + | {{#set: smiles=C(C3(C(CC(N2(C1(=C(C(=NC(=O)N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}} |
| − | + | {{#set: inchi key=InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J}} | |
| − | {{#set: | + | {{#set: common name=2-hydroxy-dATP}} |
| + | {{#set: molecular weight=503.152 }} | ||
| + | {{#set: common name=2-hydroxydeoxyadenosine 5'-triphosphate|2'-deoxyisoguanosine triphosphate}} | ||
| + | {{#set: produced by=RXN-14290}} | ||
Revision as of 21:56, 17 March 2018
Contents
Metabolite CPD-13851
- smiles:
- C(C3(C(CC(N2(C1(=C(C(=NC(=O)N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
- inchi key:
- InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J
- common name:
- 2-hydroxy-dATP
- molecular weight:
- 503.152
- Synonym(s):
- 2-hydroxydeoxyadenosine 5'-triphosphate
- 2'-deoxyisoguanosine triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C3(C(CC(N2(C1(=C(C(=NC(=O)N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O" cannot be used as a page name in this wiki.
