Difference between revisions of "RXN0-722"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(=NC(=O)N1)N)N=C2)))O3)O))OP(OP(OP(=O)...")
 
(Created page with "Category:Gene == Gene Ec-04_001020 == * left end position: ** 1140662 * transcription direction: ** NEGATIVE * right end position: ** 1143313 * centisome position: ** 17.5...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] ==
+
== Gene Ec-04_001020 ==
−
* smiles:
+
* left end position:
−
** C(C3(C(CC(N2(C1(=C(C(=NC(=O)N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
+
** 1140662
−
* inchi key:
+
* transcription direction:
−
** InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 2-hydroxy-dATP
+
** 1143313
−
* molecular weight:
+
* centisome position:
−
** 503.152    
+
** 17.51671    
 
* Synonym(s):
 
* Synonym(s):
−
** 2-hydroxydeoxyadenosine 5'-triphosphate
+
** Esi_0101_0069
−
** 2'-deoxyisoguanosine triphosphate
+
** Esi0101_0069
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[GLYOXII-RXN]]
−
* [[RXN-14290]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***go-term
 +
* [[RXN-7919]]
 +
** esiliculosus_genome
 +
***go-term
 +
== Pathways associated ==
 +
* [[PWY-5386]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1140662}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289402 86289402]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=1143313}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77897 77897]
+
{{#set: centisome position=17.51671   }}
−
{{#set: smiles=C(C3(C(CC(N2(C1(=C(C(=NC(=O)N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}}
+
{{#set: common name=Esi_0101_0069|Esi0101_0069}}
−
{{#set: inchi key=InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J}}
+
{{#set: reaction associated=GLYOXII-RXN|RXN-7919}}
−
{{#set: common name=2-hydroxy-dATP}}
+
{{#set: pathway associated=PWY-5386}}
−
{{#set: molecular weight=503.152   }}
+
−
{{#set: common name=2-hydroxydeoxyadenosine 5'-triphosphate|2'-deoxyisoguanosine triphosphate}}
+
−
{{#set: produced by=RXN-14290}}
+

Revision as of 21:57, 17 March 2018

Gene Ec-04_001020

  • left end position:
    • 1140662
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1143313
  • centisome position:
    • 17.51671
  • Synonym(s):
    • Esi_0101_0069
    • Esi0101_0069

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN0-722&oldid=15155"