Difference between revisions of "Ec-25 002110"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5881 CPD-5881] == * smiles: ** CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2)) * inchi key: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1) * inchi key: ** InCh...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L |
* common name: | * common name: | ||
− | ** | + | ** β-L-galactose 1-phosphate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 258.121 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXNQT-4142]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXNQT-4141]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71728461 71728461] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75522 75522] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15926 C15926] |
− | + | {{#set: smiles=C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)}} | |
− | {{#set: smiles= | + | {{#set: inchi key=InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=β-L-galactose 1-phosphate}} |
− | {{#set: common name= | + | {{#set: molecular weight=258.121 }} |
− | {{#set: molecular weight= | + | {{#set: consumed by=RXNQT-4142}} |
− | + | {{#set: produced by=RXNQT-4141}} | |
− | {{#set: consumed by= | + | |
− | {{#set: produced by= | + |
Revision as of 21:58, 17 March 2018
Contents
Metabolite CPDQT-4
- smiles:
- C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)
- inchi key:
- InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L
- common name:
- β-L-galactose 1-phosphate
- molecular weight:
- 258.121
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)" cannot be used as a page name in this wiki.