Difference between revisions of "RXN-9222"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-04_001920 == * left end position: ** 2120752 * transcription direction: ** POSITIVE * right end position: ** 2125277 * centisome position: ** 32.5...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14392 CPD-14392] == * smiles: ** CCC=CCC=CCC=CCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14392 CPD-14392] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCC=CCC=CCC=CCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=DDHCSALWDPRVCN-USWKVXSKSA-J |
| − | * | + | * common name: |
| − | ** | + | ** stearidonoyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 1021.905 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl-coA |
| − | + | ||
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[RXN-16041]] |
| − | + | * [[RXN-13426]] | |
| − | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70698349 70698349] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71489 71489] |
| − | {{#set: common name= | + | {{#set: smiles=CCC=CCC=CCC=CCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=DDHCSALWDPRVCN-USWKVXSKSA-J}} |
| + | {{#set: common name=stearidonoyl-CoA}} | ||
| + | {{#set: molecular weight=1021.905 }} | ||
| + | {{#set: common name=(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl-coA}} | ||
| + | {{#set: produced by=RXN-16041|RXN-13426}} | ||
Revision as of 21:58, 17 March 2018
Contents
Metabolite CPD-14392
- smiles:
- CCC=CCC=CCC=CCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=DDHCSALWDPRVCN-USWKVXSKSA-J
- common name:
- stearidonoyl-CoA
- molecular weight:
- 1021.905
- Synonym(s):
- (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl-coA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
