Difference between revisions of "Ec-23 001940"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7100 CPD-7100] == * smiles: ** CC(C(C(=O)[O-])C(=O)C(=O)[O-])C * inchi key: ** InChIKey=HII...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-Plastocyanins Oxidized-Plastocyanins] == * common name: ** an oxidized plastocyanin *...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-Plastocyanins Oxidized-Plastocyanins] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an oxidized plastocyanin |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[PLASTOQUINOL--PLASTOCYANIN-REDUCTASE-RXN]] |
| + | * [[RXN-12647]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=an oxidized plastocyanin}} | |
| − | + | {{#set: consumed by=PLASTOQUINOL--PLASTOCYANIN-REDUCTASE-RXN|RXN-12647}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: consumed by= | + | |
| − | + | ||
Revision as of 21:58, 17 March 2018
Contents
Metabolite Oxidized-Plastocyanins
- common name:
- an oxidized plastocyanin
- Synonym(s):
