Difference between revisions of "PHOSPHO-ENOL-PYRUVATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHO-ENOL-PYRUVATE PHOSPHO-ENOL-PYRUVATE] == * smiles: ** C=C(OP([O-])([O-])=O)C([O-])=O * i...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7101 RXN-7101] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With id...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7101 RXN-7101] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 2 [[BCCP-biotin-monomers]][c] '''=>''' 1 [[BCCP-dimers]][c] |
− | + | * With common name(s): | |
− | * [[ | + | ** 2 a biotinylated [BCCP monomer][c] '''=>''' 1 a biotinylated [BCCP dimer][c] |
− | + | ||
− | == | + | == Genes associated with this reaction == |
− | * [[ | + | == Pathways == |
− | + | * [[PWY0-1264]], biotin-carboxyl carrier protein assembly: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1264 PWY0-1264] | |
− | + | ** '''3''' reactions found over '''4''' reactions in the full pathway | |
− | * | + | == Reconstruction information == |
− | * [[ | + | * Category: [[annotation]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Tool: [[pathwaytools]] |
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: in pathway=PWY0-1264}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 22:58, 17 March 2018
Contents
Reaction RXN-7101
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- 2 BCCP-biotin-monomers[c] => 1 BCCP-dimers[c]
- With common name(s):
- 2 a biotinylated [BCCP monomer][c] => 1 a biotinylated [BCCP dimer][c]
Genes associated with this reaction
Pathways
- PWY0-1264, biotin-carboxyl carrier protein assembly: PWY0-1264
- 3 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome