Difference between revisions of "GLYCOLALD-DEHYDROG-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYADENOSINE DEOXYADENOSINE] == * smiles: ** C(O)C1(OC(CC(O)1)N3(C=NC2(=C(N)N=CN=C23))) * inc...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17373 CPD-17373] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP(...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17373 CPD-17373] == |
* smiles: | * smiles: | ||
− | ** C(O) | + | ** C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP([O-])(=O)[O-])=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=ZXBGEIHFXPHRJY-NKFDZXFUSA-L |
* common name: | * common name: | ||
− | ** 2 | + | ** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 728.942 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-16118]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819824 91819824] |
− | + | {{#set: smiles=C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP([O-])(=O)[O-])=O}} | |
− | + | {{#set: inchi key=InChIKey=ZXBGEIHFXPHRJY-NKFDZXFUSA-L}} | |
− | + | {{#set: common name=1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate}} | |
− | + | {{#set: molecular weight=728.942 }} | |
− | + | {{#set: produced by=RXN-16118}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: smiles=C(O) | + | |
− | {{#set: inchi key=InChIKey= | + | |
− | {{#set: common name=2 | + | |
− | {{#set: molecular weight= | + | |
− | {{#set: | + | |
− | + |
Revision as of 21:58, 17 March 2018
Contents
Metabolite CPD-17373
- smiles:
- C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP([O-])(=O)[O-])=O
- inchi key:
- InChIKey=ZXBGEIHFXPHRJY-NKFDZXFUSA-L
- common name:
- 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate
- molecular weight:
- 728.942
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP([O-])(=O)[O-])=O" cannot be used as a page name in this wiki.
"1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate" cannot be used as a page name in this wiki.