Difference between revisions of "TransportSeed CPD-3"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-02_006350 == * left end position: ** 6446425 * transcription direction: ** POSITIVE * right end position: ** 6447282 * centisome position: ** 98.7...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2)) * inchi key: ** InChIKey=Y...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-02_006350 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] ==
−
* left end position:
+
* smiles:
−
** 6446425
+
** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N
−
* right end position:
+
* common name:
−
** 6447282
+
** 7-methylurate
−
* centisome position:
+
* molecular weight:
−
** 98.75354    
+
** 182.138    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0355_0019
+
** 7-methyluric acid
−
** Esi0355_0019
+
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[NADH-DEHYDROG-A-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** esiliculosus_genome
+
* [[RXN-11521]]
−
***go-term
+
== Reaction(s) of unknown directionality ==
−
* [[NADH-DEHYDROGENASE-RXN]]
+
−
** esiliculosus_genome
+
−
***go-term
+
−
* [[RXN0-5330]]
+
−
** esiliculosus_genome
+
−
***go-term
+
−
== Pathways associated ==
+
−
* [[PWY-4302]]
+
−
* [[PWY-3781]]
+
−
* [[PWY-7269]]
+
−
* [[PWY-7279]]
+
−
* [[PWY0-1567]]
+
−
* [[PWY-6692]]
+
−
* [[PWY0-1334]]
+
−
* [[PWY0-1335]]
+
−
* [[PWY-5083]]
+
−
* [[PWY0-1568]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=6446425}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=69160 69160]
−
{{#set: right end position=6447282}}
+
* CHEMSPIDER:
−
{{#set: centisome position=98.75354   }}
+
** [http://www.chemspider.com/Chemical-Structure.62375.html 62375]
−
{{#set: common name=Esi_0355_0019|Esi0355_0019}}
+
* CHEBI:
−
{{#set: reaction associated=NADH-DEHYDROG-A-RXN|NADH-DEHYDROGENASE-RXN|RXN0-5330}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80470 80470]
−
{{#set: pathway associated=PWY-4302|PWY-3781|PWY-7269|PWY-7279|PWY0-1567|PWY-6692|PWY0-1334|PWY0-1335|PWY-5083|PWY0-1568}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C16355 C16355]
 +
* HMDB : HMDB11107
 +
{{#set: smiles=CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))}}
 +
{{#set: inchi key=InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N}}
 +
{{#set: common name=7-methylurate}}
 +
{{#set: molecular weight=182.138   }}
 +
{{#set: common name=7-methyluric acid}}
 +
{{#set: produced by=RXN-11521}}

Revision as of 22:00, 17 March 2018

Metabolite CPD-12481

  • smiles:
    • CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))
  • inchi key:
    • InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N
  • common name:
    • 7-methylurate
  • molecular weight:
    • 182.138
  • Synonym(s):
    • 7-methyluric acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=TransportSeed_CPD-3&oldid=15386"