Difference between revisions of "Ec-26 005140"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-ILE-tRNAs Charged-ILE-tRNAs] == * common name: ** an L-isoleucyl-[tRNAile] * Synonym(s)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-GLUCURONATE UDP-GLUCURONATE] == * smiles: ** C3(=CC(NC(N(C1(OC(C(C1O)O)COP(=O)(OP([O-])(OC2...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-GLUCURONATE UDP-GLUCURONATE] == |
| + | * smiles: | ||
| + | ** C3(=CC(NC(N(C1(OC(C(C1O)O)COP(=O)(OP([O-])(OC2(C(C(C(C(O2)C([O-])=O)O)O)O))=O)[O-]))3)=O)=O) | ||
| + | * inchi key: | ||
| + | ** InChIKey=HDYANYHVCAPMJV-LXQIFKJMSA-K | ||
* common name: | * common name: | ||
| − | ** | + | ** UDP-α-D-glucuronate |
| + | * molecular weight: | ||
| + | ** 577.265 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** (UDP-GlcA)1 | ||
| + | ** UDP-D-glucuronic acid | ||
| + | ** UDP-glucuronic acid | ||
| + | ** udp-glcua | ||
| + | ** UDP-glucuronate | ||
| + | ** uridine diphosphate glucuronate | ||
| + | ** uridine diphosphate glucuronic acid | ||
| + | ** UDP-D-glucuronate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[UGD-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 2616-64-0 |
| − | {{#set: | + | * BIGG : 34117 |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202620 25202620] | ||
| + | * HMDB : HMDB00935 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00167 C00167] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58052 58052] | ||
| + | * METABOLIGHTS : MTBLC58052 | ||
| + | {{#set: smiles=C3(=CC(NC(N(C1(OC(C(C1O)O)COP(=O)(OP([O-])(OC2(C(C(C(C(O2)C([O-])=O)O)O)O))=O)[O-]))3)=O)=O)}} | ||
| + | {{#set: inchi key=InChIKey=HDYANYHVCAPMJV-LXQIFKJMSA-K}} | ||
| + | {{#set: common name=UDP-α-D-glucuronate}} | ||
| + | {{#set: molecular weight=577.265 }} | ||
| + | {{#set: common name=(UDP-GlcA)1|UDP-D-glucuronic acid|UDP-glucuronic acid|udp-glcua|UDP-glucuronate|uridine diphosphate glucuronate|uridine diphosphate glucuronic acid|UDP-D-glucuronate}} | ||
| + | {{#set: consumed by=UDP-GLUCURONATE-DECARBOXYLASE-RXN}} | ||
| + | {{#set: produced by=UGD-RXN}} | ||
Revision as of 22:00, 17 March 2018
Contents
Metabolite UDP-GLUCURONATE
- smiles:
- C3(=CC(NC(N(C1(OC(C(C1O)O)COP(=O)(OP([O-])(OC2(C(C(C(C(O2)C([O-])=O)O)O)O))=O)[O-]))3)=O)=O)
- inchi key:
- InChIKey=HDYANYHVCAPMJV-LXQIFKJMSA-K
- common name:
- UDP-α-D-glucuronate
- molecular weight:
- 577.265
- Synonym(s):
- (UDP-GlcA)1
- UDP-D-glucuronic acid
- UDP-glucuronic acid
- udp-glcua
- UDP-glucuronate
- uridine diphosphate glucuronate
- uridine diphosphate glucuronic acid
- UDP-D-glucuronate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 2616-64-0
- BIGG : 34117
- PUBCHEM:
- HMDB : HMDB00935
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58052
"C3(=CC(NC(N(C1(OC(C(C1O)O)COP(=O)(OP([O-])(OC2(C(C(C(C(O2)C([O-])=O)O)O)O))=O)[O-]))3)=O)=O)" cannot be used as a page name in this wiki.
