Difference between revisions of "Ec-12 003100"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19159 CPD-19159] == * smiles: ** CCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...")
 
(Created page with "Category:Gene == Gene Ec-03_002180 == * left end position: ** 2663850 * transcription direction: ** POSITIVE * right end position: ** 2672990 * centisome position: ** 40.8...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19159 CPD-19159] ==
+
== Gene Ec-03_002180 ==
−
* smiles:
+
* left end position:
−
** CCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 2663850
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SCDXBWNPJAGEEK-KBOAXVDLSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (S)-3-hydroxy-(11Z)-octadecenoyl-CoA
+
** 2672990
−
* molecular weight:
+
* centisome position:
−
** 1043.952    
+
** 40.802395    
 
* Synonym(s):
 
* Synonym(s):
−
** (S)-3-hydroxy-18:1-Δ11-CoA
+
** Esi_0011_0107
−
** (S)-3-hydroxy-11-cis-octadecenoyl-CoA
+
** Esi0011_0107
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17786]]
+
* [[1.5.1.20-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
* [[RXN-17785]]
+
***go-term
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-2201]]
 +
* [[1CMET2-PWY]]
 +
* [[PWY-3841]]
 +
* [[CODH-PWY]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=2663850}}
−
{{#set: inchi key=InChIKey=SCDXBWNPJAGEEK-KBOAXVDLSA-J}}
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: common name=(S)-3-hydroxy-(11Z)-octadecenoyl-CoA}}
+
{{#set: right end position=2672990}}
−
{{#set: molecular weight=1043.952   }}
+
{{#set: centisome position=40.802395   }}
−
{{#set: common name=(S)-3-hydroxy-18:1-Δ11-CoA|(S)-3-hydroxy-11-cis-octadecenoyl-CoA}}
+
{{#set: common name=Esi_0011_0107|Esi0011_0107}}
−
{{#set: consumed by=RXN-17786}}
+
{{#set: reaction associated=1.5.1.20-RXN}}
−
{{#set: produced by=RXN-17785}}
+
{{#set: pathway associated=PWY-2201|1CMET2-PWY|PWY-3841|CODH-PWY}}

Revision as of 22:01, 17 March 2018

Gene Ec-03_002180

  • left end position:
    • 2663850
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2672990
  • centisome position:
    • 40.802395
  • Synonym(s):
    • Esi_0011_0107
    • Esi0011_0107

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-12_003100&oldid=15431"