Difference between revisions of "RXN-9653"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9653 RXN-9653] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxoacyl-[acyl-carrier-prote...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-437 CPD1F-437] == * smiles: ** C1(C=C(O)C(O)=CC=1C3(OC4(C=C([O-])C=C(O)C(C(=O)C(OC2(OC(CO...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9653 RXN-9653] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-437 CPD1F-437] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(C=C(O)C(O)=CC=1C3(OC4(C=C([O-])C=C(O)C(C(=O)C(OC2(OC(CO)C(O)C(O)C(O)2))=3)=4)))
 +
* inchi key:
 +
** InChIKey=OVSQVDMCBVZWGM-QSOFNFLRSA-M
 
* common name:
 
* common name:
−
** 3-oxoacyl-[acyl-carrier-protein] synthase
+
** quercetin-3-glucoside
−
** Beta-ketoacyl synthase, N-terminal
+
* molecular weight:
−
** Thiolase-like, subgroup
+
** 463.374   
−
** beta-ketoacyl synthase, partial
+
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
+
−
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
+
−
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** quercetin-3-O-β-D-glucoside
 +
** isoquercetin
 +
** isoquercitrin
 +
** isotrifoliin
 +
** glucosyl 3-quercetin
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[MALONYL-COA]][c] '''+''' 1 [[Dodecanoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[3-oxo-myristoyl-ACPs]][c] '''+''' 1 [[CO-A]][c]
+
* [[RXN1F-462]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 malonyl-CoA[c] '''+''' 1 a dodecanoyl-[acp][c] '''+''' 1 H+[c] '''=>''' 1 CO2[c] '''+''' 1 a 3-oxo-myristoyl-[acp][c] '''+''' 1 coenzyme A[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-12_000650]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
* [[Ec-27_002090]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-12_000640]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-27_003480]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
+
−
** '''20''' reactions found over '''31''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=3-oxoacyl-[acyl-carrier-protein] synthase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203368 25203368]
−
{{#set: common name=Beta-ketoacyl synthase, N-terminal}}
+
* CHEBI:
−
{{#set: common name=Thiolase-like, subgroup}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28299 28299]
−
{{#set: common name=beta-ketoacyl synthase, partial}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-2.3.1.86}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05623 C05623]
−
{{#set: ec number=EC-2.3.1.85}}
+
* HMDB : HMDB37362
−
{{#set: ec number=EC-2.3.1.41}}
+
{{#set: smiles=C1(C=C(O)C(O)=CC=1C3(OC4(C=C([O-])C=C(O)C(C(=O)C(OC2(OC(CO)C(O)C(O)C(O)2))=3)=4)))}}
−
{{#set: gene associated=Ec-12_000650|Ec-27_002090|Ec-12_000640|Ec-27_003480}}
+
{{#set: inchi key=InChIKey=OVSQVDMCBVZWGM-QSOFNFLRSA-M}}
−
{{#set: in pathway=PWY-5994}}
+
{{#set: common name=quercetin-3-glucoside}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=463.374    }}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=quercetin-3-O-β-D-glucoside|isoquercetin|isoquercitrin|isotrifoliin|glucosyl 3-quercetin}}
−
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: produced by=RXN1F-462}}

Revision as of 22:01, 17 March 2018

Metabolite CPD1F-437

  • smiles:
    • C1(C=C(O)C(O)=CC=1C3(OC4(C=C([O-])C=C(O)C(C(=O)C(OC2(OC(CO)C(O)C(O)C(O)2))=3)=4)))
  • inchi key:
    • InChIKey=OVSQVDMCBVZWGM-QSOFNFLRSA-M
  • common name:
    • quercetin-3-glucoside
  • molecular weight:
    • 463.374
  • Synonym(s):
    • quercetin-3-O-β-D-glucoside
    • isoquercetin
    • isoquercitrin
    • isotrifoliin
    • glucosyl 3-quercetin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(C=C(O)C(O)=CC=1C3(OC4(C=C([O-])C=C(O)C(C(=O)C(OC2(OC(CO)C(O)C(O)C(O)2))=3)=4)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-9653&oldid=15438"