Difference between revisions of "Ec-03 004860"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AN-ALPHA-L-FUCOSIDE AN-ALPHA-L-FUCOSIDE] == * smiles: ** CC1(OC(O[R])C(O)C(O)C(O)1) * common na...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15685 CPD-15685] == * smiles: ** CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15685 CPD-15685] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
+ | * inchi key: | ||
+ | ** InChIKey=XPVHXTGUZGACRU-MCFMHTHASA-J | ||
* common name: | * common name: | ||
− | ** | + | ** 2-trans, 5-cis, 7-trans-tetradecatrienoyl-CoA |
+ | * molecular weight: | ||
+ | ** 967.814 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2E, 5Z, 7E-tetradecatrienoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-14796]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657959 90657959] |
− | + | {{#set: smiles=CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
− | + | {{#set: inchi key=InChIKey=XPVHXTGUZGACRU-MCFMHTHASA-J}} | |
− | {{#set: smiles= | + | {{#set: common name=2-trans, 5-cis, 7-trans-tetradecatrienoyl-CoA}} |
− | {{#set: common name= | + | {{#set: molecular weight=967.814 }} |
− | {{#set: | + | {{#set: common name=2E, 5Z, 7E-tetradecatrienoyl-CoA}} |
+ | {{#set: produced by=RXN-14796}} |
Revision as of 22:01, 17 March 2018
Contents
Metabolite CPD-15685
- smiles:
- CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=XPVHXTGUZGACRU-MCFMHTHASA-J
- common name:
- 2-trans, 5-cis, 7-trans-tetradecatrienoyl-CoA
- molecular weight:
- 967.814
- Synonym(s):
- 2E, 5Z, 7E-tetradecatrienoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.