Difference between revisions of "Ec-18 004660"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-HYDROXYPYRUVATE 3-P-HYDROXYPYRUVATE] == * smiles: ** C(OP([O-])(=O)[O-])C(=O)C(=O)[O-] * in...") |
(Created page with "Category:Gene == Gene Ec-26_004480 == * left end position: ** 4688545 * transcription direction: ** NEGATIVE * right end position: ** 4690993 * centisome position: ** 71.2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-26_004480 == |
− | * | + | * left end position: |
− | ** | + | ** 4688545 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4690993 |
− | * | + | * centisome position: |
− | ** | + | ** 71.21825 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0280_0026 |
− | ** | + | ** Esi0280_0026 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * [[RXN-15556]] | |
− | + | ** esiliculosus_genome | |
− | * [[ | + | ***automated-name-match |
− | * [[ | + | == Pathways associated == |
+ | * [[PWY-7511]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4688545}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4690993}} | |
− | + | {{#set: centisome position=71.21825 }} | |
− | + | {{#set: common name=Esi_0280_0026|Esi0280_0026}} | |
− | + | {{#set: reaction associated=RXN-15556}} | |
− | + | {{#set: pathway associated=PWY-7511}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 22:01, 17 March 2018
Gene Ec-26_004480
- left end position:
- 4688545
- transcription direction:
- NEGATIVE
- right end position:
- 4690993
- centisome position:
- 71.21825
- Synonym(s):
- Esi_0280_0026
- Esi0280_0026
Reactions associated
- RXN-15556
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome