Difference between revisions of "IS30-with-Integrated-Transposon"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-676 CPD-676] == * smiles: ** C([O-])(=O)C=CC1(C=C(O)C(O)=CC=1) * inchi key: ** InChIKey=QAI...") |
(Created page with "Category:Gene == Gene Ec-26_000990 == * left end position: ** 1361535 * transcription direction: ** POSITIVE * right end position: ** 1365048 * centisome position: ** 20.6...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-26_000990 == |
− | * | + | * left end position: |
− | ** | + | ** 1361535 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 1365048 |
− | * | + | * centisome position: |
− | ** | + | ** 20.6815 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0451_0019 |
− | ** | + | ** Esi0451_0019 |
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]] |
− | * [[RXN- | + | ** esiliculosus_genome |
− | + | ***automated-name-match | |
− | == | + | * [[RXN-7253]] |
+ | ** esiliculosus_genome | ||
+ | ***automated-name-match | ||
+ | * [[RXN0-5408]] | ||
+ | ** esiliculosus_genome | ||
+ | ***automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-4702]] | ||
+ | * [[PWY-2301]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1361535}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=1365048}} | |
− | + | {{#set: centisome position=20.6815 }} | |
− | + | {{#set: common name=Esi_0451_0019|Esi0451_0019}} | |
− | + | {{#set: reaction associated=MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN|RXN-7253|RXN0-5408}} | |
− | + | {{#set: pathway associated=PWY-4702|PWY-2301}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 22:02, 17 March 2018
Gene Ec-26_000990
- left end position:
- 1361535
- transcription direction:
- POSITIVE
- right end position:
- 1365048
- centisome position:
- 20.6815
- Synonym(s):
- Esi_0451_0019
- Esi0451_0019
Reactions associated
- MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome
- RXN-7253
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome
- RXN0-5408
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome