Difference between revisions of "Ec-13 004610"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8120 CPD-8120] == * smiles: ** CCCCCC=CCC=CCC=CCCCCCCC(=O)[O-] * common name: ** di-homo-&g...") |
(Created page with "Category:Gene == Gene Ec-02_005260 == * left end position: ** 5541497 * transcription direction: ** POSITIVE * right end position: ** 5543771 * centisome position: ** 84.8...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-02_005260 == |
− | * | + | * left end position: |
− | ** | + | ** 5541497 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 5543771 |
− | * | + | * centisome position: |
− | ** | + | ** 84.89085 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0024_0152 |
− | ** | + | ** Esi0024_0152 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * [[GLYOXIII-RXN]] | |
− | * [[ | + | ** esiliculosus_genome |
− | == | + | ***automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5541497}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=5543771}} | |
− | + | {{#set: centisome position=84.89085 }} | |
− | + | {{#set: common name=Esi_0024_0152|Esi0024_0152}} | |
− | + | {{#set: reaction associated=GLYOXIII-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 22:03, 17 March 2018
Gene Ec-02_005260
- left end position:
- 5541497
- transcription direction:
- POSITIVE
- right end position:
- 5543771
- centisome position:
- 84.89085
- Synonym(s):
- Esi_0024_0152
- Esi0024_0152
Reactions associated
- GLYOXIII-RXN
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome