Difference between revisions of "RXN-11784"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-13_002270 == * Synonym(s): ** Esi_0363_0004 ** Esi0363_0004 == Reactions associated == * ATPASE-RXN ** pantograph-aragem == Pathways...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-204 CPD-204] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-204 CPD-204] == |
+ | * smiles: | ||
+ | ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O))) | ||
+ | * inchi key: | ||
+ | ** InChIKey=WZRRJZYYGOOHRC-AXLMTQBOSA-M | ||
+ | * common name: | ||
+ | ** gibberellin A8 | ||
+ | * molecular weight: | ||
+ | ** 363.386 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** GA8 |
− | ** | + | ** 2β-hydroxygibberellin 1 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-115]] | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203521 25203521] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28861 28861] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C03579 C03579] | ||
+ | {{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}} | ||
+ | {{#set: inchi key=InChIKey=WZRRJZYYGOOHRC-AXLMTQBOSA-M}} | ||
+ | {{#set: common name=gibberellin A8}} | ||
+ | {{#set: molecular weight=363.386 }} | ||
+ | {{#set: common name=GA8|2β-hydroxygibberellin 1}} | ||
+ | {{#set: produced by=RXN-115}} |
Revision as of 22:03, 17 March 2018
Contents
Metabolite CPD-204
- smiles:
- C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
- inchi key:
- InChIKey=WZRRJZYYGOOHRC-AXLMTQBOSA-M
- common name:
- gibberellin A8
- molecular weight:
- 363.386
- Synonym(s):
- GA8
- 2β-hydroxygibberellin 1
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.