Difference between revisions of "Ec-14 005710"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINAMIDE_RIBOSE NICOTINAMIDE_RIBOSE] == * smiles: ** C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Ketopimeloyl-ACP-methyl-esters 3-Ketopimeloyl-ACP-methyl-esters] == * common name: ** a 3-oxo...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINAMIDE_RIBOSE NICOTINAMIDE_RIBOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Ketopimeloyl-ACP-methyl-esters 3-Ketopimeloyl-ACP-methyl-esters] ==
−
* smiles:
+
−
** C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)N)C=2))
+
−
* inchi key:
+
−
** InChIKey=JLEBZPBDRKPWTD-TURQNECASA-O
+
 
* common name:
 
* common name:
−
** 1-(β-D ribofuranosyl)nicotinamide
+
** a 3-oxo-pimeloyl-[acp] methyl ester
−
* molecular weight:
+
−
** 255.25   
+
 
* Synonym(s):
 
* Synonym(s):
−
** β-nicotinamide D-ribonucleotide
+
** a 3-ketopimelyl-[acp] methyl ester
−
** N-ribosyl-nicotinamide
+
** a 3-ketopimeloyl-[acyl-carrier protein] methyl ester
−
** nicotinamide ribonucleoside
+
** a 3-oxo-pimelyl-[acp] methyl ester
−
** nicotinamide ribose
+
** a 3-ketopimeloyl-[acp] methyl ester
−
** nicotinamide riboside
+
−
** ribosylnicotinamide
+
−
** nicotinamide-β-riboside
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11480]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-5841]]
+
* [[RXN-11479]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* CAS : 1341-23-7
+
{{#set: common name=a 3-oxo-pimeloyl-[acp] methyl ester}}
−
* PUBCHEM:
+
{{#set: common name=a 3-ketopimelyl-[acp] methyl ester|a 3-ketopimeloyl-[acyl-carrier protein] methyl ester|a 3-oxo-pimelyl-[acp] methyl ester|a 3-ketopimeloyl-[acp] methyl ester}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439924 439924]
+
{{#set: consumed by=RXN-11480}}
−
* HMDB : HMDB00855
+
{{#set: produced by=RXN-11479}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C03150 C03150]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.915.html 915]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15927 15927]
+
−
* METABOLIGHTS : MTBLC15927
+
−
{{#set: smiles=C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)N)C=2))}}
+
−
{{#set: inchi key=InChIKey=JLEBZPBDRKPWTD-TURQNECASA-O}}
+
−
{{#set: common name=1-(β-D ribofuranosyl)nicotinamide}}
+
−
{{#set: molecular weight=255.25    }}
+
−
{{#set: common name=β-nicotinamide D-ribonucleotide|N-ribosyl-nicotinamide|nicotinamide ribonucleoside|nicotinamide ribose|nicotinamide riboside|ribosylnicotinamide|nicotinamide-β-riboside}}
+
−
{{#set: produced by=RXN-5841}}
+

Revision as of 22:03, 17 March 2018

Metabolite 3-Ketopimeloyl-ACP-methyl-esters

  • common name:
    • a 3-oxo-pimeloyl-[acp] methyl ester
  • Synonym(s):
    • a 3-ketopimelyl-[acp] methyl ester
    • a 3-ketopimeloyl-[acyl-carrier protein] methyl ester
    • a 3-oxo-pimelyl-[acp] methyl ester
    • a 3-ketopimeloyl-[acp] methyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a 3-oxo-pimeloyl-[acp] methyl ester" cannot be used as a page name in this wiki.
  • "a 3-ketopimelyl-[acp] methyl ester" cannot be used as a page name in this wiki.
  • "a 3-ketopimeloyl-[acyl-carrier protein] methyl ester" cannot be used as a page name in this wiki.
  • "a 3-oxo-pimelyl-[acp] methyl ester" cannot be used as a page name in this wiki.
  • "a 3-ketopimeloyl-[acp] methyl ester" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-14_005710&oldid=15588"