Difference between revisions of "Ec-08 002600"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10814 RXN-10814] == * direction: ** REVERSIBLE * common name: ** Aspartate Aminotransferase **...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] == * smiles: ** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2)) * inchi key: ** In...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10814 RXN-10814] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))
 +
* inchi key:
 +
** InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N
 
* common name:
 
* common name:
−
** Aspartate Aminotransferase
+
** serotonin O-sulfate
−
** aspartate aminotransferase
+
* molecular weight:
−
** Pyridoxal phosphate-dependent transferase, major region, subdomain 1
+
** 256.276   
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/2.6.1.1 EC-2.6.1.1]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 5-hydroxytryptamine O-sulfate
 +
** 3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate
 +
** 1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[PHE]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''<=>''' 1 [[GLT]][c] '''+''' 1 [[PHENYL-PYRUVATE]][c]
+
* [[RXN-10777]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 L-phenylalanine[c] '''+''' 1 2-oxoglutarate[c] '''<=>''' 1 L-glutamate[c] '''+''' 1 2-oxo-3-phenylpropanoate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-23_003500]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-01_007480]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-03_003270]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6318]], L-phenylalanine degradation IV (mammalian, via side chain): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6318 PWY-6318]
+
−
** '''4''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=Aspartate Aminotransferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=152151 152151]
−
{{#set: common name=aspartate aminotransferase}}
+
* CHEMSPIDER:
−
{{#set: common name=Pyridoxal phosphate-dependent transferase, major region, subdomain 1}}
+
** [http://www.chemspider.com/Chemical-Structure.134104.html 134104]
−
{{#set: ec number=EC-2.6.1.1}}
+
{{#set: smiles=C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))}}
−
{{#set: gene associated=Ec-23_003500|Ec-01_007480|Ec-03_003270}}
+
{{#set: inchi key=InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N}}
−
{{#set: in pathway=PWY-6318}}
+
{{#set: common name=serotonin O-sulfate}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=256.276    }}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=5-hydroxytryptamine O-sulfate|3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate|1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)}}
−
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: produced by=RXN-10777}}

Revision as of 22:03, 17 March 2018

Metabolite CPD-11665

  • smiles:
    • C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))
  • inchi key:
    • InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N
  • common name:
    • serotonin O-sulfate
  • molecular weight:
    • 256.276
  • Synonym(s):
    • 5-hydroxytryptamine O-sulfate
    • 3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate
    • 1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-08_002600&oldid=15591"