Difference between revisions of "Ec-08 002170"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHINE XANTHINE] == * smiles: ** C12(NC(=O)NC(C=1N=CN2)=O) * inchi key: ** InChIKey=LRFVTYWOQ...") |
(Created page with "Category:Gene == Gene Ec-18_003740 == * left end position: ** 3669665 * transcription direction: ** NEGATIVE * right end position: ** 3676157 * centisome position: ** 74.4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-18_003740 == |
− | * | + | * left end position: |
− | ** | + | ** 3669665 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3676157 |
− | * | + | * centisome position: |
− | ** | + | ** 74.48742 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0022_0102 |
+ | ** Esi0022_0102 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[RXN-7741]] |
− | == | + | ** esiliculosus_genome |
− | * [[ | + | ***automated-name-match |
− | + | == Pathways associated == | |
− | * [[ | + | * [[PWY-5098]] |
+ | * [[PWY-6927]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3669665}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3676157}} | |
− | + | {{#set: centisome position=74.48742 }} | |
− | + | {{#set: common name=Esi_0022_0102|Esi0022_0102}} | |
− | + | {{#set: reaction associated=RXN-7741}} | |
− | + | {{#set: pathway associated=PWY-5098|PWY-6927}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 22:04, 17 March 2018
Gene Ec-18_003740
- left end position:
- 3669665
- transcription direction:
- NEGATIVE
- right end position:
- 3676157
- centisome position:
- 74.48742
- Synonym(s):
- Esi_0022_0102
- Esi0022_0102
Reactions associated
- RXN-7741
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome