Difference between revisions of "Ec-01 007190"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4081 CPD-4081] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2C...")
 
(Created page with "Category:Gene == Gene Ec-19_000120 == * Synonym(s): ** Esi_0328_0037 ** Esi0328_0037 == Reactions associated == * RXN-8443 ** pantograph-aragem == Pathways as...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4081 CPD-4081] ==
+
== Gene Ec-19_000120 ==
* smiles:
+
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
+
* inchi key:
+
** InChIKey=QLDNWJOJCDIMKK-XLFBYWHPSA-N
+
* common name:
+
** 4α-methyl-5α-ergosta-8,24-dien-3β-ol
+
* molecular weight:
+
** 412.698   
+
 
* Synonym(s):
 
* Synonym(s):
** 4α-methyl-5α-ergosta-8,14,24(28)-dien-3β-ol
+
** Esi_0328_0037
** 4α-methyl-5α-ergosta-8,24-dien-3β-ol
+
** Esi0328_0037
** 4α-methylfecosterol
+
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[RXN-8443]]
* [[RXN-4144]]
+
** [[pantograph]]-[[aragem]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=Esi_0328_0037|Esi0328_0037}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=193524 193524]
+
{{#set: reaction associated=RXN-8443}}
* CHEBI:
+
{{#set: pathway associated=PWY-5381}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80094 80094]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C15776 C15776]
+
* HMDB : HMDB06845
+
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=QLDNWJOJCDIMKK-XLFBYWHPSA-N}}
+
{{#set: common name=4α-methyl-5α-ergosta-8,24-dien-3β-ol}}
+
{{#set: molecular weight=412.698    }}
+
{{#set: common name=4α-methyl-5α-ergosta-8,14,24(28)-dien-3β-ol|4α-methyl-5α-ergosta-8,24-dien-3β-ol|4α-methylfecosterol}}
+
{{#set: produced by=RXN-4144}}
+

Revision as of 22:04, 17 March 2018

Gene Ec-19_000120

  • Synonym(s):
    • Esi_0328_0037
    • Esi0328_0037

Reactions associated

Pathways associated

External links