Difference between revisions of "Ec-08 002400"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-520 CPD-520] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3))) * in...")
 
(Created page with "Category:Gene == Gene Ec-13_004610 == * Synonym(s): ** Esi_0106_0084 ** Esi0106_0084 == Reactions associated == * RXN-8443 ** pantograph-aragem == Pathways as...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-520 CPD-520] ==
+
== Gene Ec-13_004610 ==
−
* smiles:
+
−
** C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3)))
+
−
* inchi key:
+
−
** InChIKey=REFJWTPEDVJJIY-UHFFFAOYSA-M
+
−
* common name:
+
−
** quercetin
+
−
* molecular weight:
+
−
** 301.232   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3,5,7,3',4'-pentahydroxyflavone
+
** Esi_0106_0084
−
** 3,5,7,3',4'-pentahydroflavone
+
** Esi0106_0084
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN1F-462]]
+
* [[RXN-8443]]
−
== Reaction(s) known to produce the compound ==
+
** [[pantograph]]-[[aragem]]
−
* [[RXN-527]]
+
== Pathways associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
−
* NCI:
+
{{#set: common name=Esi_0106_0084|Esi0106_0084}}
−
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=9219 9219]
+
{{#set: reaction associated=RXN-8443}}
−
* CAS : 117-39-5
+
{{#set: pathway associated=PWY-5381}}
−
* Wikipedia : Quercetin
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46906036 46906036]
+
−
* HMDB : HMDB05794
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00389 C00389]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57694 57694]
+
−
{{#set: smiles=C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3)))}}
+
−
{{#set: inchi key=InChIKey=REFJWTPEDVJJIY-UHFFFAOYSA-M}}
+
−
{{#set: common name=quercetin}}
+
−
{{#set: molecular weight=301.232    }}
+
−
{{#set: common name=3,5,7,3',4'-pentahydroxyflavone|3,5,7,3',4'-pentahydroflavone}}
+
−
{{#set: consumed by=RXN1F-462}}
+
−
{{#set: produced by=RXN-527}}
+

Revision as of 22:04, 17 March 2018

Gene Ec-13_004610

  • Synonym(s):
    • Esi_0106_0084
    • Esi0106_0084

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-08_002400&oldid=15662"