Difference between revisions of "Protein-With-N-Terminal-X-Pro"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-21_006260 == * left end position: ** 7106523 * transcription direction: ** POSITIVE * right end position: ** 7109593 * centisome position: ** 96.2...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8122 CPD-8122] == * smiles: ** C(OP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=NC3(C(N)=NC...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-21_006260 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8122 CPD-8122] ==
−
* left end position:
+
* smiles:
−
** 7106523
+
** C(OP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=NC3(C(N)=NC=NC2=3))))C5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N)))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K
−
* right end position:
+
* common name:
−
** 7109593
+
** molybdopterin adenine dinucleotide
−
* centisome position:
+
* molecular weight:
−
** 96.2928    
+
** 721.529    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0014_0175
+
** adenylated molybdopterin
−
** Esi0014_0175
+
** H2Dtpp-mADP
 +
** molybdopterin-AMP
 +
** adenylyl-molybdopterin
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN-11370]]
+
* [[RXN-8348]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
* [[RXN-8344]]
−
* [[RXN-11373]]
+
== Reaction(s) of unknown directionality ==
−
** esiliculosus_genome
+
−
***ec-number
+
−
* [[RXN-11374]]
+
−
** esiliculosus_genome
+
−
***ec-number
+
−
* [[RXN-14326]]
+
−
** esiliculosus_genome
+
−
***ec-number
+
−
== Pathways associated ==
+
−
* [[PWY-6482]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=7106523}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53356704 53356704]
−
{{#set: right end position=7109593}}
+
* CHEBI:
−
{{#set: centisome position=96.2928   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62727 62727]
−
{{#set: common name=Esi_0014_0175|Esi0014_0175}}
+
{{#set: smiles=C(OP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=NC3(C(N)=NC=NC2=3))))C5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N)))}}
−
{{#set: reaction associated=RXN-11370|RXN-11373|RXN-11374|RXN-14326}}
+
{{#set: inchi key=InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K}}
−
{{#set: pathway associated=PWY-6482}}
+
{{#set: common name=molybdopterin adenine dinucleotide}}
 +
{{#set: molecular weight=721.529   }}
 +
{{#set: common name=adenylated molybdopterin|H2Dtpp-mADP|molybdopterin-AMP|adenylyl-molybdopterin}}
 +
{{#set: consumed by=RXN-8348}}
 +
{{#set: produced by=RXN-8344}}

Revision as of 22:04, 17 March 2018

Metabolite CPD-8122

  • smiles:
    • C(OP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=NC3(C(N)=NC=NC2=3))))C5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N)))
  • inchi key:
    • InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K
  • common name:
    • molybdopterin adenine dinucleotide
  • molecular weight:
    • 721.529
  • Synonym(s):
    • adenylated molybdopterin
    • H2Dtpp-mADP
    • molybdopterin-AMP
    • adenylyl-molybdopterin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=NC3(C(N)=NC=NC2=3))))C5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N)))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Protein-With-N-Terminal-X-Pro&oldid=15669"