Difference between revisions of "Ec-14 002670"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7005 CPD-7005] == * smiles: ** C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=...")
 
(Created page with "Category:Gene == Gene Ec-13_004810 == * Synonym(s): ** Esi_0450_0002 ** Esi0450_0002 == Reactions associated == * RXN-8443 ** pantograph-aragem == Pathways as...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7005 CPD-7005] ==
+
== Gene Ec-13_004810 ==
−
* smiles:
+
−
** C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(N=1)=C7([C-](C(OC)=O)C(=O)C6(C(C)=C4(N([Mg]N(C2=CC3(C(C)=C(CC)C(N=3)=C4))5)C=67))))))
+
−
* inchi key:
+
−
** InChIKey=QBLSEPRESQJTCI-ZNLWZYPOSA-M
+
−
* common name:
+
−
** geranylgeranyl chlorophyll a
+
−
* molecular weight:
+
−
** 886.447   
+
 
* Synonym(s):
 
* Synonym(s):
−
** geranylgeranyl-chl a
+
** Esi_0450_0002
−
** GG-chl a
+
** Esi0450_0002
−
** GG-chlorophyll a
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-7664]]
+
* [[RXN-8443]]
−
* [[RXN-17428]]
+
** [[pantograph]]-[[aragem]]
−
== Reaction(s) known to produce the compound ==
+
== Pathways associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=Esi_0450_0002|Esi0450_0002}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657538 90657538]
+
{{#set: reaction associated=RXN-8443}}
−
* CHEBI:
+
{{#set: pathway associated=PWY-5381}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64668 64668]
+
−
{{#set: smiles=C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(N=1)=C7([C-](C(OC)=O)C(=O)C6(C(C)=C4(N([Mg]N(C2=CC3(C(C)=C(CC)C(N=3)=C4))5)C=67))))))}}
+
−
{{#set: inchi key=InChIKey=QBLSEPRESQJTCI-ZNLWZYPOSA-M}}
+
−
{{#set: common name=geranylgeranyl chlorophyll a}}
+
−
{{#set: molecular weight=886.447    }}
+
−
{{#set: common name=geranylgeranyl-chl a|GG-chl a|GG-chlorophyll a}}
+
−
{{#set: consumed by=RXN-7664|RXN-17428}}
+

Revision as of 22:04, 17 March 2018

Gene Ec-13_004810

  • Synonym(s):
    • Esi_0450_0002
    • Esi0450_0002

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-14_002670&oldid=15676"