Difference between revisions of "CPD-7005"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-06_007300 == * left end position: ** 4971520 * transcription direction: ** NEGATIVE * right end position: ** 4976838 * centisome position: ** 56.7...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMP DIMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi ke...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-06_007300 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMP DIMP] ==
−
* left end position:
+
* smiles:
−
** 4971520
+
** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=PHNGFPPXDJJADG-RRKCRQDMSA-L
−
* right end position:
+
* common name:
−
** 4976838
+
** dIMP
−
* centisome position:
+
* molecular weight:
−
** 56.76704    
+
** 330.193    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0411_0021
+
** 2'-deoxy-IMP
−
** Esi0411_0021
+
** 2'-deoxy-5'-inosinic acid
 +
** 2'-Deoxyinosine 5'-monophosphate
 +
** 2'-Deoxyinosine 5'-phosphate
 +
** 9-(2-deoxy-5-O-phosphono-β-D-erythro-pentofuranosyl)-9H-purin-6-ol
 +
** Deoxyinosine monophosphate
 +
** Hypoxanthine deoxyriboside
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[ARYL-SULFOTRANSFERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** esiliculosus_genome
+
* [[RXN0-1602]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
* [[RXN-10614]]
+
−
** esiliculosus_genome
+
−
***ec-number
+
−
* [[RXN-10615]]
+
−
** esiliculosus_genome
+
−
***ec-number
+
−
* [[RXN-10777]]
+
−
** esiliculosus_genome
+
−
***ec-number
+
−
* [[RXN-10782]]
+
−
** esiliculosus_genome
+
−
***ec-number
+
−
* [[RXN-11058]]
+
−
** esiliculosus_genome
+
−
***ec-number
+
−
* [[RXN-11059]]
+
−
** esiliculosus_genome
+
−
***ec-number
+
−
* [[RXN-15587]]
+
−
** esiliculosus_genome
+
−
***ec-number
+
−
* [[RXN-15588]]
+
−
** esiliculosus_genome
+
−
***ec-number
+
−
* [[RXN-15589]]
+
−
** esiliculosus_genome
+
−
***ec-number
+
−
* [[RXN6666-9]]
+
−
** esiliculosus_genome
+
−
***ec-number
+
−
== Pathways associated ==
+
−
* [[PWY6666-2]]
+
−
* [[PWY-6261]]
+
−
* [[PWY-6313]]
+
−
* [[PWY-6398]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=4971520}}
+
* BIGG : 47635
−
{{#set: transcription direction=NEGATIVE}}
+
* PUBCHEM:
−
{{#set: right end position=4976838}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22841129 22841129]
−
{{#set: centisome position=56.76704   }}
+
* HMDB : HMDB06555
−
{{#set: common name=Esi_0411_0021|Esi0411_0021}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=ARYL-SULFOTRANSFERASE-RXN|RXN-10614|RXN-10615|RXN-10777|RXN-10782|RXN-11058|RXN-11059|RXN-15587|RXN-15588|RXN-15589|RXN6666-9}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C06196 C06196]
−
{{#set: pathway associated=PWY6666-2|PWY-6261|PWY-6313|PWY-6398}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.18596798.html 18596798]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61194 61194]
 +
* METABOLIGHTS : MTBLC61194
 +
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))}}
 +
{{#set: inchi key=InChIKey=PHNGFPPXDJJADG-RRKCRQDMSA-L}}
 +
{{#set: common name=dIMP}}
 +
{{#set: molecular weight=330.193   }}
 +
{{#set: common name=2'-deoxy-IMP|2'-deoxy-5'-inosinic acid|2'-Deoxyinosine 5'-monophosphate|2'-Deoxyinosine 5'-phosphate|9-(2-deoxy-5-O-phosphono-β-D-erythro-pentofuranosyl)-9H-purin-6-ol|Deoxyinosine monophosphate|Hypoxanthine deoxyriboside}}
 +
{{#set: produced by=RXN0-1602}}

Revision as of 22:04, 17 March 2018

Metabolite DIMP

  • smiles:
    • C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))
  • inchi key:
    • InChIKey=PHNGFPPXDJJADG-RRKCRQDMSA-L
  • common name:
    • dIMP
  • molecular weight:
    • 330.193
  • Synonym(s):
    • 2'-deoxy-IMP
    • 2'-deoxy-5'-inosinic acid
    • 2'-Deoxyinosine 5'-monophosphate
    • 2'-Deoxyinosine 5'-phosphate
    • 9-(2-deoxy-5-O-phosphono-β-D-erythro-pentofuranosyl)-9H-purin-6-ol
    • Deoxyinosine monophosphate
    • Hypoxanthine deoxyriboside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-7005&oldid=15679"