Difference between revisions of "Ec-02 001880"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=...")
 
(Created page with "Category:Gene == Gene Ec-01_008900 == * left end position: ** 7525434 * transcription direction: ** NEGATIVE * right end position: ** 7540443 * centisome position: ** 72.9...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] ==
+
== Gene Ec-01_008900 ==
−
* smiles:
+
* left end position:
−
** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
+
** 7525434
−
* inchi key:
+
* transcription direction:
−
** InChIKey=AQIVLFLYHYFRKU-VPENINKCSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 8-oxo-dGMP
+
** 7540443
−
* molecular weight:
+
* centisome position:
−
** 361.207    
+
** 72.929115    
 
* Synonym(s):
 
* Synonym(s):
−
** 8-oxo-7,8-dihydro-2'-dGMP
+
** Esi_0203_0013
−
** 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-monophosphate
+
** Esi0203_0013
−
** 8-oxo-deoxyguanosine-monophosphate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** esiliculosus_genome
−
* [[RXN-14205]]
+
***go-term
 +
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=7525434}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173535 46173535]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=7540443}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63224 63224]
+
{{#set: centisome position=72.929115   }}
−
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}}
+
{{#set: common name=Esi_0203_0013|Esi0203_0013}}
−
{{#set: inchi key=InChIKey=AQIVLFLYHYFRKU-VPENINKCSA-L}}
+
{{#set: reaction associated=UBIQUITIN--PROTEIN-LIGASE-RXN}}
−
{{#set: common name=8-oxo-dGMP}}
+
{{#set: pathway associated=PWY-7511}}
−
{{#set: molecular weight=361.207   }}
+
−
{{#set: common name=8-oxo-7,8-dihydro-2'-dGMP|8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-monophosphate|8-oxo-deoxyguanosine-monophosphate}}
+
−
{{#set: consumed or produced by=RXN-14205}}
+

Revision as of 22:04, 17 March 2018

Gene Ec-01_008900

  • left end position:
    • 7525434
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 7540443
  • centisome position:
    • 72.929115
  • Synonym(s):
    • Esi_0203_0013
    • Esi0203_0013

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-02_001880&oldid=15692"