Difference between revisions of "Ec-16 002130"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-497 CPD-497] == * smiles: ** C1(=C(C(=O)NC(=O)N1)C2(OC(CO)C(O)C(O)2)) * inchi key: ** InChI...") |
(Created page with "Category:Gene == Gene Ec-06_001290 == * left end position: ** 866755 * transcription direction: ** NEGATIVE * right end position: ** 871868 * centisome position: ** 9.8969...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-06_001290 == |
− | * | + | * left end position: |
− | ** | + | ** 866755 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 871868 |
− | * | + | * centisome position: |
− | ** | + | ** 9.8969965 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0309_0016 | ||
+ | ** Esi0309_0016 | ||
+ | ** PABS | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[PABASYN-RXN]] |
− | + | ** esiliculosus_genome | |
− | == | + | ***ec-number |
+ | ** [[pantograph]]-[[aragem]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6543]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=866755}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=871868}} | |
− | + | {{#set: centisome position=9.8969965 }} | |
− | + | {{#set: common name=Esi_0309_0016|Esi0309_0016|PABS}} | |
− | + | {{#set: reaction associated=PABASYN-RXN}} | |
− | + | {{#set: pathway associated=PWY-6543}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 22:04, 17 March 2018
Gene Ec-06_001290
- left end position:
- 866755
- transcription direction:
- NEGATIVE
- right end position:
- 871868
- centisome position:
- 9.8969965
- Synonym(s):
- Esi_0309_0016
- Esi0309_0016
- PABS
Reactions associated
- PABASYN-RXN
- esiliculosus_genome
- ec-number
- pantograph-aragem
- esiliculosus_genome