Difference between revisions of "Ec-27 004000"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARIN COUMARIN] == * smiles: ** C1(OC2(=CC=CC=C(C=C1)2))=O * inchi key: ** InChIKey=ZYGHJZDH...") |
(Created page with "Category:Gene == Gene Ec-03_002400 == * left end position: ** 2865911 * transcription direction: ** NEGATIVE * right end position: ** 2880016 * centisome position: ** 43.8...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-03_002400 == |
− | * | + | * left end position: |
− | ** | + | ** 2865911 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 2880016 |
− | * | + | * centisome position: |
− | ** | + | ** 43.897377 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0011_0074 |
− | ** | + | ** Esi0011_0074 |
+ | ** CDKH1 | ||
− | == | + | == Reactions associated == |
− | + | * [[PROTEIN-KINASE-RXN]] | |
− | * [[ | + | ** esiliculosus_genome |
− | == | + | ***ec-number |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2865911}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=2880016}} | |
− | + | {{#set: centisome position=43.897377 }} | |
− | + | {{#set: common name=Esi_0011_0074|Esi0011_0074|CDKH1}} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 22:04, 17 March 2018
Gene Ec-03_002400
- left end position:
- 2865911
- transcription direction:
- NEGATIVE
- right end position:
- 2880016
- centisome position:
- 43.897377
- Synonym(s):
- Esi_0011_0074
- Esi0011_0074
- CDKH1
Reactions associated
- PROTEIN-KINASE-RXN
- esiliculosus_genome
- ec-number
- esiliculosus_genome